4-[7-[6-(4-isopropylpiperazin-1-yl)-3-pyridyl]imidazo[1,2-a]pyridin-3-yl]-2-methyl-quinoline

ID: ALA4741939

PubChem CID: 139326708

Max Phase: Preclinical

Molecular Formula: C29H30N6

Molecular Weight: 462.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3cc(-c4ccc(N5CCN(C(C)C)CC5)nc4)ccn23)c2ccccc2n1

Standard InChI:  InChI=1S/C29H30N6/c1-20(2)33-12-14-34(15-13-33)28-9-8-23(18-30-28)22-10-11-35-27(19-31-29(35)17-22)25-16-21(3)32-26-7-5-4-6-24(25)26/h4-11,16-20H,12-15H2,1-3H3

Standard InChI Key:  MIQNNSWBNZHANG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   19.1792   -5.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1792   -6.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8886   -6.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8886   -5.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5939   -5.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5939   -6.4102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3719   -6.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8544   -6.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3719   -5.3411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4686   -5.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4675   -4.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7553   -3.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0437   -4.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0488   -5.1954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7615   -5.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3302   -3.9601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3272   -3.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6177   -2.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9094   -3.1383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9109   -3.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6208   -4.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3667   -7.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6544   -7.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6488   -8.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3542   -9.1104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0686   -7.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0657   -8.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7656   -9.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4688   -8.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4677   -7.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7672   -7.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9384   -9.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2015   -2.7300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2011   -1.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4939   -3.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  1 10  1  0
 13 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  7 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 27  1  0
 26 22  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  2  0
 24 32  1  0
 19 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741939

    ---

Associated Targets(Human)

ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.60Molecular Weight (Monoisotopic): 462.2532AlogP: 5.45#Rotatable Bonds: 4
Polar Surface Area: 49.56Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.05CX LogP: 4.37CX LogD: 3.62
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.52

References

1. Engers DW,Bollinger SR,Felts AS,Vadukoot AK,Williams CH,Blobaum AL,Lindsley CW,Hong CC,Hopkins CR.  (2020)  Discovery, synthesis and characterization of a series of 7-aryl-imidazo[1,2-a]pyridine-3-ylquinolines as activin-like kinase (ALK) inhibitors.,  30  (18): [PMID:32750526] [10.1016/j.bmcl.2020.127418]

Source