The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-hydroxy-3,5-dimethylbenzylidene)-2-oxoindolin-5-yl)-3-morpholinopropanamide ID: ALA4741943
PubChem CID: 162647152
Max Phase: Preclinical
Molecular Formula: C24H27N3O4
Molecular Weight: 421.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(/C=C2/C(=O)Nc3ccc(NC(=O)CCN4CCOCC4)cc32)cc(C)c1O
Standard InChI: InChI=1S/C24H27N3O4/c1-15-11-17(12-16(2)23(15)29)13-20-19-14-18(3-4-21(19)26-24(20)30)25-22(28)5-6-27-7-9-31-10-8-27/h3-4,11-14,29H,5-10H2,1-2H3,(H,25,28)(H,26,30)/b20-13+
Standard InChI Key: YRRKUWAOFPVMTL-DEDYPNTBSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
42.2160 -29.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2149 -30.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9229 -30.5442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9211 -28.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6297 -29.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6300 -30.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4086 -30.3834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.8897 -29.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4082 -29.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5082 -28.9072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8006 -29.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0928 -28.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8008 -30.1332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3852 -29.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6774 -28.9079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9698 -29.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6772 -28.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2619 -28.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9694 -27.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2617 -28.0911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.7069 -29.7207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6605 -28.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1135 -27.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3698 -26.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8236 -26.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0233 -26.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7723 -27.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3202 -27.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4755 -25.8558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.0762 -25.5223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9736 -27.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
20 19 1 0
8 21 2 0
9 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
25 30 1 0
27 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.50Molecular Weight (Monoisotopic): 421.2002AlogP: 3.16#Rotatable Bonds: 5Polar Surface Area: 90.90Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.06CX Basic pKa: 7.07CX LogP: 3.14CX LogD: 2.97Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -1.20
References 1. Yao D,Ruhan A,Jiang J,Huang J,Wang J,Han W. (2020) Design, synthesis and biological evaluation of 2-indolinone derivatives as PAK1 inhibitors in MDA-MB-231 cells., 30 (17): [PMID:32738980 ] [10.1016/j.bmcl.2020.127355 ]