The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl)-4-(4-methoxyphenyl)butanamide ID: ALA4741966
PubChem CID: 162647415
Max Phase: Preclinical
Molecular Formula: C32H38N4O7
Molecular Weight: 590.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC[C@@H](NC(=O)[C@H](COCc2ccccc2)NC(C)=O)C(=O)N[C@H](Cc2ccccc2)C(=O)NO)cc1
Standard InChI: InChI=1S/C32H38N4O7/c1-22(37)33-29(21-43-20-25-11-7-4-8-12-25)31(39)34-27(18-15-23-13-16-26(42-2)17-14-23)30(38)35-28(32(40)36-41)19-24-9-5-3-6-10-24/h3-14,16-17,27-29,41H,15,18-21H2,1-2H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t27-,28-,29+/m1/s1
Standard InChI Key: LIWJGPAGHBDEIK-NLDZOOGBSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
32.1252 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8396 -5.3458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4107 -5.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1252 -6.5834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5542 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2687 -5.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9831 -5.7583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2687 -4.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6976 -5.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4121 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6976 -4.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4121 -6.5834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1265 -5.3458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8410 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5555 -5.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8410 -6.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5555 -6.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2699 -5.7583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9844 -5.3458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5555 -4.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5516 -7.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2653 -8.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9808 -7.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9780 -6.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2639 -6.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5542 -6.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2687 -6.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2687 -7.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9831 -8.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9808 -9.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6944 -9.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4098 -9.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4072 -8.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6930 -7.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4121 -4.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4121 -3.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1286 -2.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1289 -2.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4139 -1.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6970 -2.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7002 -2.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4128 -0.8096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1266 -0.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
9 11 1 6
10 12 2 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 1 1
16 17 1 0
15 18 1 0
18 19 1 0
15 20 2 0
17 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 17 1 0
5 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
11 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.68Molecular Weight (Monoisotopic): 590.2740AlogP: 2.07#Rotatable Bonds: 16Polar Surface Area: 155.09Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.72CX Basic pKa: ┄CX LogP: 2.28CX LogD: 2.26Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.13Np Likeness Score: -0.06
References 1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M. (2020) Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease., 63 (21): [PMID:33107733 ] [10.1021/acs.jmedchem.0c01285 ]