(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl)-4-(4-methoxyphenyl)butanamide

ID: ALA4741966

PubChem CID: 162647415

Max Phase: Preclinical

Molecular Formula: C32H38N4O7

Molecular Weight: 590.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CC[C@@H](NC(=O)[C@H](COCc2ccccc2)NC(C)=O)C(=O)N[C@H](Cc2ccccc2)C(=O)NO)cc1

Standard InChI:  InChI=1S/C32H38N4O7/c1-22(37)33-29(21-43-20-25-11-7-4-8-12-25)31(39)34-27(18-15-23-13-16-26(42-2)17-14-23)30(38)35-28(32(40)36-41)19-24-9-5-3-6-10-24/h3-14,16-17,27-29,41H,15,18-21H2,1-2H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t27-,28-,29+/m1/s1

Standard InChI Key:  LIWJGPAGHBDEIK-NLDZOOGBSA-N

Molfile:  

 
     RDKit          2D

 43 45  0  0  0  0  0  0  0  0999 V2000
   32.1252   -5.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8396   -5.3458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4107   -5.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1252   -6.5834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5542   -5.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2687   -5.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9831   -5.7583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2687   -4.5208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6976   -5.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4121   -5.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6976   -4.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4121   -6.5834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1265   -5.3458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8410   -5.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5555   -5.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8410   -6.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5555   -6.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2699   -5.7583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9844   -5.3458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5555   -4.5208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5516   -7.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2653   -8.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9808   -7.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9780   -6.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2639   -6.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5542   -6.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2687   -6.9959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2687   -7.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9831   -8.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9808   -9.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6944   -9.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4098   -9.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4072   -8.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6930   -7.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4121   -4.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4121   -3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1286   -2.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1289   -2.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4139   -1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6970   -2.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7002   -2.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4128   -0.8096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1266   -0.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 39 42  1  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741966

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 590.68Molecular Weight (Monoisotopic): 590.2740AlogP: 2.07#Rotatable Bonds: 16
Polar Surface Area: 155.09Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 2.28CX LogD: 2.26
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.13Np Likeness Score: -0.06

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source