2-(2-(9-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-9H-carbazol-3-yl)vinyl)-1-methylpyridinium iodide

ID: ALA4742038

PubChem CID: 162646380

Max Phase: Preclinical

Molecular Formula: C27H31IN2O3

Molecular Weight: 431.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCOCCOCCn1c2ccccc2c2cc(/C=C/c3cccc[n+]3C)ccc21.[I-]

Standard InChI:  InChI=1S/C27H31N2O3.HI/c1-28-14-6-5-7-23(28)12-10-22-11-13-27-25(21-22)24-8-3-4-9-26(24)29(27)15-16-31-19-20-32-18-17-30-2;/h3-14,21H,15-20H2,1-2H3;1H/q+1;/p-1

Standard InChI Key:  MJVDWGWQDFLTSB-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   14.5939   -5.9391    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   12.3390   -7.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3379   -7.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0459   -8.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7556   -7.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7527   -7.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0441   -6.6487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6312   -6.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9236   -7.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2158   -6.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2192   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5122   -5.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5140   -7.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8065   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8079   -5.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0274   -5.5774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0251   -6.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5462   -6.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7336   -6.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3989   -7.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8829   -7.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6938   -7.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0417   -5.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7750   -4.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9756   -4.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7232   -3.8529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9239   -3.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6714   -2.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8721   -2.7357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6197   -1.9585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8203   -1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5679   -1.0113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7686   -0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 15  2  0
 14 13  2  0
 13 10  1  0
 14 15  1  0
 15 16  1  0
 16 18  1  0
 17 14  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  7 23  1  0
 16 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
M  CHG  2   1  -1   7   1
M  END

Associated Targets(Human)

quadruplex DNA (2700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.56Molecular Weight (Monoisotopic): 431.2329AlogP: 4.47#Rotatable Bonds: 11
Polar Surface Area: 36.50Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.12CX LogD: 0.12
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.59

References

1. Yu QQ,Wang MQ.  (2020)  Carbazole-based fluorescent probes for G-quadruplex DNA targeting with superior selectivity and low cytotoxicity.,  28  (17): [PMID:32773092] [10.1016/j.bmc.2020.115641]

Source