The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(9-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-9H-carbazol-3-yl)vinyl)-1-methylpyridinium iodide ID: ALA4742038
PubChem CID: 162646380
Max Phase: Preclinical
Molecular Formula: C27H31IN2O3
Molecular Weight: 431.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOCCOCCn1c2ccccc2c2cc(/C=C/c3cccc[n+]3C)ccc21.[I-]
Standard InChI: InChI=1S/C27H31N2O3.HI/c1-28-14-6-5-7-23(28)12-10-22-11-13-27-25(21-22)24-8-3-4-9-26(24)29(27)15-16-31-19-20-32-18-17-30-2;/h3-14,21H,15-20H2,1-2H3;1H/q+1;/p-1
Standard InChI Key: MJVDWGWQDFLTSB-UHFFFAOYSA-M
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
14.5939 -5.9391 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
12.3390 -7.0575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3379 -7.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0459 -8.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7556 -7.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7527 -7.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0441 -6.6487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6312 -6.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9236 -7.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2158 -6.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2192 -5.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5122 -5.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5140 -7.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8065 -6.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8079 -5.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0274 -5.5774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0251 -6.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5462 -6.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7336 -6.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3989 -7.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8829 -7.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6938 -7.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0417 -5.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7750 -4.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9756 -4.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7232 -3.8529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9239 -3.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6714 -2.9057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8721 -2.7357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6197 -1.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8203 -1.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5679 -1.0113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7686 -0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
2 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 15 2 0
14 13 2 0
13 10 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 14 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
7 23 1 0
16 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M CHG 2 1 -1 7 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.56Molecular Weight (Monoisotopic): 431.2329AlogP: 4.47#Rotatable Bonds: 11Polar Surface Area: 36.50Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.12CX LogD: 0.12Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.59
References 1. Yu QQ,Wang MQ. (2020) Carbazole-based fluorescent probes for G-quadruplex DNA targeting with superior selectivity and low cytotoxicity., 28 (17): [PMID:32773092 ] [10.1016/j.bmc.2020.115641 ]