(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-3-(4-chlorophenyl)-1-(hydroxyamino)-1-oxopropan-2-yl)-4-phenylbutanamide

ID: ALA4742155

PubChem CID: 162645360

Max Phase: Preclinical

Molecular Formula: C31H35ClN4O6

Molecular Weight: 595.10

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)NO

Standard InChI:  InChI=1S/C31H35ClN4O6/c1-21(37)33-28(20-42-19-24-10-6-3-7-11-24)30(39)34-26(17-14-22-8-4-2-5-9-22)29(38)35-27(31(40)36-41)18-23-12-15-25(32)16-13-23/h2-13,15-16,26-28,41H,14,17-20H2,1H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t26-,27-,28+/m1/s1

Standard InChI Key:  BOAIUHCEGYHOIP-FCEKVYKBSA-N

Molfile:  

 
     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   31.1585   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8730   -5.7834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4440   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1585   -7.0209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5874   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3019   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0165   -6.1959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3019   -4.9584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7309   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4454   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7309   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4454   -7.0209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1599   -5.7834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8743   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5888   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8743   -7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5888   -7.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3033   -6.1959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.0177   -5.7834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5888   -4.9584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5850   -8.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2986   -8.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0140   -8.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0114   -7.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2972   -7.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5874   -7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3019   -7.4334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3019   -8.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0165   -8.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0141   -9.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7277   -9.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4432   -9.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4406   -8.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7263   -8.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4454   -4.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4454   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1618   -3.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1622   -2.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4471   -2.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7303   -2.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7335   -3.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7291   -8.6709    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742155

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.10Molecular Weight (Monoisotopic): 594.2245AlogP: 2.71#Rotatable Bonds: 15
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 3.04CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.19

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source