(S)-methyl 2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)-3-phenylpropanoate

ID: ALA4742164

PubChem CID: 146558903

Max Phase: Preclinical

Molecular Formula: C23H26N2O3

Molecular Weight: 378.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C23H26N2O3/c1-28-22(26)20(13-15-7-3-2-4-8-15)24-23(27)25-21-18-11-5-9-16(18)14-17-10-6-12-19(17)21/h2-4,7-8,14,20H,5-6,9-13H2,1H3,(H2,24,25,27)/t20-/m0/s1

Standard InChI Key:  INCAQYZCPRUSCC-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   15.1353  -26.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5654  -27.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8489  -28.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1344  -27.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5239  -28.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8610  -28.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6800  -28.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2805  -28.0824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9942  -27.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7095  -28.0797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9926  -26.8437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8472  -26.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5620  -26.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1756  -26.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8402  -25.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0192  -25.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4231  -27.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1383  -28.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8520  -27.6632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1398  -28.9020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5672  -28.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4215  -26.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1352  -26.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8512  -26.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5645  -26.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5634  -25.6014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8431  -25.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1329  -25.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 17 22  1  1
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742164

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.47Molecular Weight (Monoisotopic): 378.1943AlogP: 3.57#Rotatable Bonds: 5
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: CX LogP: 4.97CX LogD: 4.97
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: -0.43

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source