The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-N-ethyl-2-(11-oxo-10,11-dihydro-5H-dibenzo[b,e][1,4]diazepin-5-yl)acetamide ID: ALA4742171
PubChem CID: 162645369
Max Phase: Preclinical
Molecular Formula: C24H23N3O2
Molecular Weight: 385.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(Cc1ccccc1)C(=O)CN1c2ccccc2NC(=O)c2ccccc21
Standard InChI: InChI=1S/C24H23N3O2/c1-2-26(16-18-10-4-3-5-11-18)23(28)17-27-21-14-8-6-12-19(21)24(29)25-20-13-7-9-15-22(20)27/h3-15H,2,16-17H2,1H3,(H,25,29)
Standard InChI Key: FGGXRZQVSPMHPD-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
11.7706 -5.2461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1771 -7.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3889 -7.0624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5230 -5.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7113 -6.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5015 -6.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1040 -6.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9111 -5.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1212 -5.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8806 -6.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0213 -5.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4068 -5.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6514 -5.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5141 -6.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1298 -6.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5347 -7.8059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7453 -4.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4470 -3.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4219 -3.1628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1737 -4.3779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1234 -2.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6951 -2.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9935 -3.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0983 -1.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8034 -1.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7787 -0.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0514 -0.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3476 -0.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3758 -1.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
1 4 1 0
5 2 1 0
2 3 1 0
3 10 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 16 2 0
1 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
19 22 1 0
22 23 1 0
21 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 385.47Molecular Weight (Monoisotopic): 385.1790AlogP: 4.44#Rotatable Bonds: 5Polar Surface Area: 52.65Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.96CX LogD: 3.96Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -1.12
References 1. Sokias R,Werry EL,Alison Cheng HW,Lloyd JH,Sohler G,Danon JJ,Montgomery AP,Du JJ,Gao Q,Hibbs DE,Ittner LM,Reekie TA,Kassiou M. (2020) Tricyclic heterocycles display diverse sensitivity to the A147T TSPO polymorphism., 207 [PMID:32920427 ] [10.1016/j.ejmech.2020.112725 ]