The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4742185
PubChem CID: 154970041
Max Phase: Preclinical
Molecular Formula: C26H30FN7O3
Molecular Weight: 507.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC(=O)NCCOc2ccc(F)cc2C(=O)N2CCCC[C@H]2c2cc3nc(N4CCC4)cc1n3n2
Standard InChI: InChI=1S/C26H30FN7O3/c1-31-16-24(35)28-8-12-37-21-7-6-17(27)13-18(21)26(36)33-11-3-2-5-20(33)19-14-23-29-22(32-9-4-10-32)15-25(31)34(23)30-19/h6-7,13-15,20H,2-5,8-12,16H2,1H3,(H,28,35)/t20-/m0/s1
Standard InChI Key: XIIKHHWEUPXXNS-FQEVSTJZSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
13.4754 -21.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4754 -22.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1807 -22.4397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1807 -20.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8860 -21.2181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8905 -22.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6700 -22.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1473 -21.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6627 -20.9610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9622 -21.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3735 -22.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1872 -22.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5957 -21.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1843 -20.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3645 -20.9054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7690 -22.4466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9794 -22.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7690 -23.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5587 -23.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1807 -19.9882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4730 -19.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9527 -20.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3581 -19.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1356 -20.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1751 -19.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5804 -18.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1685 -18.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3471 -18.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9455 -18.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1284 -18.7948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6864 -18.2209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2877 -18.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7474 -19.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3976 -18.7760 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5461 -22.3201 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.4895 -19.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3657 -18.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4754 -19.0502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 16 1 0
2 16 1 0
4 20 1 0
20 33 1 0
20 21 1 0
15 22 1 0
22 23 1 0
22 24 2 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
29 30 1 0
31 32 1 0
32 33 1 0
26 34 1 0
10 35 1 6
30 36 1 0
36 37 1 0
37 31 1 0
32 38 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.57Molecular Weight (Monoisotopic): 507.2394AlogP: 2.39#Rotatable Bonds: 1Polar Surface Area: 95.31Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: 3.67CX LogP: 2.32CX LogD: 2.32Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.54Np Likeness Score: -1.22
References 1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M. (2020) Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties., 28 (24): [PMID:33190073 ] [10.1016/j.bmc.2020.115818 ]