NA

ID: ALA4742185

PubChem CID: 154970041

Max Phase: Preclinical

Molecular Formula: C26H30FN7O3

Molecular Weight: 507.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CC(=O)NCCOc2ccc(F)cc2C(=O)N2CCCC[C@H]2c2cc3nc(N4CCC4)cc1n3n2

Standard InChI:  InChI=1S/C26H30FN7O3/c1-31-16-24(35)28-8-12-37-21-7-6-17(27)13-18(21)26(36)33-11-3-2-5-20(33)19-14-23-29-22(32-9-4-10-32)15-25(31)34(23)30-19/h6-7,13-15,20H,2-5,8-12,16H2,1H3,(H,28,35)/t20-/m0/s1

Standard InChI Key:  XIIKHHWEUPXXNS-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   13.4754  -21.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4754  -22.0353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1807  -22.4397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1807  -20.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8860  -21.2181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8905  -22.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6700  -22.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1473  -21.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6627  -20.9610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9622  -21.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3735  -22.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1872  -22.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5957  -21.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1843  -20.9045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3645  -20.9054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7690  -22.4466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9794  -22.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7690  -23.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5587  -23.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1807  -19.9882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4730  -19.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9527  -20.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3581  -19.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1356  -20.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1751  -19.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5804  -18.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1685  -18.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3471  -18.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9455  -18.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1284  -18.7948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6864  -18.2209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2877  -18.9608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7474  -19.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3976  -18.7760    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5461  -22.3201    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.4895  -19.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3657  -18.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4754  -19.0502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  8 10  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 16  1  0
  2 16  1  0
  4 20  1  0
 20 33  1  0
 20 21  1  0
 15 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 29 30  1  0
 31 32  1  0
 32 33  1  0
 26 34  1  0
 10 35  1  6
 30 36  1  0
 36 37  1  0
 37 31  1  0
 32 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4742185

    ---

Associated Targets(non-human)

F Fusion glycoprotein F0 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.57Molecular Weight (Monoisotopic): 507.2394AlogP: 2.39#Rotatable Bonds: 1
Polar Surface Area: 95.31Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.49CX Basic pKa: 3.67CX LogP: 2.32CX LogD: 2.32
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.54Np Likeness Score: -1.22

References

1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M.  (2020)  Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties.,  28  (24): [PMID:33190073] [10.1016/j.bmc.2020.115818]

Source