The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2-Chloro-4-(3-methyl-2-oxopyridin-1-(2H)-yl)phenyl)-N-methyl-1H-indazole-3-carboxamide ID: ALA4742230
PubChem CID: 162645791
Max Phase: Preclinical
Molecular Formula: C21H17ClN4O2
Molecular Weight: 392.85
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1n[nH]c2cc(-c3ccc(-n4cccc(C)c4=O)cc3Cl)ccc12
Standard InChI: InChI=1S/C21H17ClN4O2/c1-12-4-3-9-26(21(12)28)14-6-8-15(17(22)11-14)13-5-7-16-18(10-13)24-25-19(16)20(27)23-2/h3-11H,1-2H3,(H,23,27)(H,24,25)
Standard InChI Key: SCGLCFWDLLLGPT-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
17.3948 -8.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8160 -7.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4059 -7.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5821 -7.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5698 -8.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1634 -7.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3483 -7.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2509 -8.7760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0059 -9.1236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7426 -7.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9243 -6.5867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9551 -7.6359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6405 -7.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0426 -8.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8664 -8.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2859 -7.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8756 -7.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0531 -7.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6461 -6.3931 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.3493 -7.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1106 -7.8419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5121 -8.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3331 -8.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7547 -7.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3490 -7.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5217 -7.1291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1162 -6.4112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7692 -6.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
7 10 1 0
10 11 2 0
10 12 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
12 20 1 0
16 21 1 0
21 22 1 0
21 26 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.85Molecular Weight (Monoisotopic): 392.1040AlogP: 3.70#Rotatable Bonds: 3Polar Surface Area: 79.78Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.81CX Basic pKa: ┄CX LogP: 3.33CX LogD: 3.33Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.56Np Likeness Score: -1.63
References 1. Zhang M,Fang X,Wang C,Hua Y,Huang C,Wang M,Zhu L,Wang Z,Gao Y,Zhang T,Liu H,Zhang Y,Lu S,Lu T,Chen Y,Li H. (2020) Design and synthesis of 1H-indazole-3-carboxamide derivatives as potent and selective PAK1 inhibitors with anti-tumour migration and invasion activities., 203 [PMID:32846314 ] [10.1016/j.ejmech.2020.112517 ]