The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-(6-(3-chlorophenyl)-4-oxo-7-((3-(4-(trifluoromethyl)phenoxy)propyl)carbamoyl)quinazolin-3(4H)-yl)acetate ID: ALA4742329
PubChem CID: 156788061
Max Phase: Preclinical
Molecular Formula: C28H23ClF3N3O5
Molecular Weight: 573.96
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cn1cnc2cc(C(=O)NCCCOc3ccc(C(F)(F)F)cc3)c(-c3cccc(Cl)c3)cc2c1=O
Standard InChI: InChI=1S/C28H23ClF3N3O5/c1-39-25(36)15-35-16-34-24-14-22(21(13-23(24)27(35)38)17-4-2-5-19(29)12-17)26(37)33-10-3-11-40-20-8-6-18(7-9-20)28(30,31)32/h2,4-9,12-14,16H,3,10-11,15H2,1H3,(H,33,37)
Standard InChI Key: ASXLKFZOIWDSCU-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
9.0060 -13.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0049 -14.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7197 -14.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7179 -12.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4332 -13.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4366 -14.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1557 -14.4685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8760 -14.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8726 -13.2184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1489 -12.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1444 -11.9776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2915 -12.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2949 -11.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5812 -11.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8659 -11.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8687 -12.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2902 -14.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5761 -14.0540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2895 -15.2920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5767 -13.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8614 -14.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1473 -14.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1479 -13.2280 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4325 -14.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7185 -14.0518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5858 -12.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3014 -13.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0146 -12.7993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3040 -14.0389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7302 -13.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0037 -14.4637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2924 -14.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5781 -14.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5770 -15.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2961 -15.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0074 -15.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8599 -15.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1602 -15.2320 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2182 -16.4753 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1437 -16.0100 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
1 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 20 2 0
20 12 1 0
16 23 1 0
2 17 1 0
17 18 1 0
17 19 2 0
18 21 1 0
21 22 1 0
22 24 1 0
24 25 1 0
9 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
25 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
37 38 1 0
37 39 1 0
37 40 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.96Molecular Weight (Monoisotopic): 573.1278AlogP: 5.11#Rotatable Bonds: 9Polar Surface Area: 99.52Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.66CX LogP: 4.48CX LogD: 4.48Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.35
References 1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G. (2020) Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy., 207 [PMID:32920426 ] [10.1016/j.ejmech.2020.112723 ]