Methyl 2-(6-(3-chlorophenyl)-4-oxo-7-((3-(4-(trifluoromethyl)phenoxy)propyl)carbamoyl)quinazolin-3(4H)-yl)acetate

ID: ALA4742329

PubChem CID: 156788061

Max Phase: Preclinical

Molecular Formula: C28H23ClF3N3O5

Molecular Weight: 573.96

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)Cn1cnc2cc(C(=O)NCCCOc3ccc(C(F)(F)F)cc3)c(-c3cccc(Cl)c3)cc2c1=O

Standard InChI:  InChI=1S/C28H23ClF3N3O5/c1-39-25(36)15-35-16-34-24-14-22(21(13-23(24)27(35)38)17-4-2-5-19(29)12-17)26(37)33-10-3-11-40-20-8-6-18(7-9-20)28(30,31)32/h2,4-9,12-14,16H,3,10-11,15H2,1H3,(H,33,37)

Standard InChI Key:  ASXLKFZOIWDSCU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    9.0060  -13.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0049  -14.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7197  -14.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7179  -12.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4332  -13.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4366  -14.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1557  -14.4685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8760  -14.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8726  -13.2184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1489  -12.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1444  -11.9776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2915  -12.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2949  -11.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5812  -11.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8659  -11.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8687  -12.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2902  -14.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5761  -14.0540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2895  -15.2920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5767  -13.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8614  -14.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1473  -14.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1479  -13.2280    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.4325  -14.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7185  -14.0518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5858  -12.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3014  -13.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0146  -12.7993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3040  -14.0389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7302  -13.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0037  -14.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2924  -14.0491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5781  -14.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5770  -15.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2961  -15.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0074  -15.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8599  -15.7020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1602  -15.2320    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2182  -16.4753    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.1437  -16.0100    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 20  2  0
 20 12  1  0
 16 23  1  0
  2 17  1  0
 17 18  1  0
 17 19  2  0
 18 21  1  0
 21 22  1  0
 22 24  1  0
 24 25  1  0
  9 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 25 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 37 38  1  0
 37 39  1  0
 37 40  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742329

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 573.96Molecular Weight (Monoisotopic): 573.1278AlogP: 5.11#Rotatable Bonds: 9
Polar Surface Area: 99.52Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 3.66CX LogP: 4.48CX LogD: 4.48
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.35

References

1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G.  (2020)  Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy.,  207  [PMID:32920426] [10.1016/j.ejmech.2020.112723]

Source