((2S,3R,4S,5S)-5-(6-Amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl ((R)-3-hydroxy-2,2-dimethyl-4-oxo-4-((3-oxo-3-(propylamino)propyl)amino)butyl) glutarate

ID: ALA4742648

PubChem CID: 162646921

Max Phase: Preclinical

Molecular Formula: C27H41N7O10

Molecular Weight: 623.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COC(=O)CCCC(=O)OC[C@@H]1O[C@H](n2cnc3c(N)ncnc32)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C27H41N7O10/c1-4-9-29-16(35)8-10-30-25(41)22(40)27(2,3)12-43-18(37)7-5-6-17(36)42-11-15-20(38)21(39)26(44-15)34-14-33-19-23(28)31-13-32-24(19)34/h13-15,20-22,26,38-40H,4-12H2,1-3H3,(H,29,35)(H,30,41)(H2,28,31,32)/t15-,20-,21-,22-,26-/m0/s1

Standard InChI Key:  XAICVKDJPIUPOP-UUPPINRVSA-N

Molfile:  

 
     RDKit          2D

 44 46  0  0  0  0  0  0  0  0999 V2000
   26.5779  -15.1469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5768  -15.9664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2848  -16.3754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2830  -14.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9917  -15.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9919  -15.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7749  -16.2206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2586  -15.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7745  -14.8887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2806  -13.9208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7668  -17.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0978  -17.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3424  -18.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1590  -18.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4189  -17.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6328  -18.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3231  -17.2530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8555  -18.9486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4466  -18.9646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8566  -19.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6738  -19.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4494  -20.3800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0838  -20.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9009  -20.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3109  -21.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9038  -21.7906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1281  -21.0804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3497  -20.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3538  -21.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0595  -21.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5367  -21.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7639  -22.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5811  -22.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9911  -23.1942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9883  -21.7788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3562  -23.1972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8083  -23.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2155  -22.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0327  -22.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4399  -21.7740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4427  -23.1894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.0299  -21.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4371  -20.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0271  -19.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  1  0
 11  7  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 14 16  1  1
 12 17  1  6
 13 18  1  6
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 29 28  1  0
 30 29  1  0
 31 29  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 32 36  1  6
 34 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  2  0
 40 42  1  0
 42 43  1  0
 43 44  1  0
 31 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742648

    ---

Associated Targets(Human)

AURKA Tchem Serine/threonine-protein kinase Aurora-A (10240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 623.66Molecular Weight (Monoisotopic): 623.2915AlogP: -1.30#Rotatable Bonds: 16
Polar Surface Area: 250.34Molecular Species: NEUTRALHBA: 15HBD: 6
#RO5 Violations: 3HBA (Lipinski): 17HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.26CX Basic pKa: 4.92CX LogP: -1.78CX LogD: -1.78
Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: 0.32

References

1. Bellany F,Tsuchiya Y,Tran TM,Chan AWE,Allan H,Gout I,Tabor AB.  (2020)  Design and synthesis of Coenzyme A analogues as Aurora kinase A inhibitors: An exploration of the roles of the pyrophosphate and pantetheine moieties.,  28  (22): [PMID:33007553] [10.1016/j.bmc.2020.115740]

Source