The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((2S,3R,4S,5S)-5-(6-Amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl ((R)-3-hydroxy-2,2-dimethyl-4-oxo-4-((3-oxo-3-(propylamino)propyl)amino)butyl) glutarate ID: ALA4742648
PubChem CID: 162646921
Max Phase: Preclinical
Molecular Formula: C27H41N7O10
Molecular Weight: 623.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COC(=O)CCCC(=O)OC[C@@H]1O[C@H](n2cnc3c(N)ncnc32)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C27H41N7O10/c1-4-9-29-16(35)8-10-30-25(41)22(40)27(2,3)12-43-18(37)7-5-6-17(36)42-11-15-20(38)21(39)26(44-15)34-14-33-19-23(28)31-13-32-24(19)34/h13-15,20-22,26,38-40H,4-12H2,1-3H3,(H,29,35)(H,30,41)(H2,28,31,32)/t15-,20-,21-,22-,26-/m0/s1
Standard InChI Key: XAICVKDJPIUPOP-UUPPINRVSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
26.5779 -15.1469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5768 -15.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2848 -16.3754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2830 -14.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9917 -15.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9919 -15.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7749 -16.2206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2586 -15.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7745 -14.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2806 -13.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7668 -17.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0978 -17.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3424 -18.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1590 -18.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4189 -17.5263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6328 -18.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3231 -17.2530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8555 -18.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4466 -18.9646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8566 -19.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6738 -19.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4494 -20.3800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0838 -20.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9009 -20.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3109 -21.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9038 -21.7906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1281 -21.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3497 -20.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3538 -21.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0595 -21.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5367 -21.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7639 -22.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5811 -22.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9911 -23.1942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9883 -21.7788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3562 -23.1972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8083 -23.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2155 -22.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0327 -22.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4399 -21.7740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4427 -23.1894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0299 -21.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4371 -20.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0271 -19.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
11 7 1 1
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
14 16 1 1
12 17 1 6
13 18 1 6
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
29 28 1 0
30 29 1 0
31 29 1 0
29 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
32 36 1 6
34 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
39 41 2 0
40 42 1 0
42 43 1 0
43 44 1 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 623.66Molecular Weight (Monoisotopic): 623.2915AlogP: -1.30#Rotatable Bonds: 16Polar Surface Area: 250.34Molecular Species: NEUTRALHBA: 15HBD: 6#RO5 Violations: 3HBA (Lipinski): 17HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.26CX Basic pKa: 4.92CX LogP: -1.78CX LogD: -1.78Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: 0.32
References 1. Bellany F,Tsuchiya Y,Tran TM,Chan AWE,Allan H,Gout I,Tabor AB. (2020) Design and synthesis of Coenzyme A analogues as Aurora kinase A inhibitors: An exploration of the roles of the pyrophosphate and pantetheine moieties., 28 (22): [PMID:33007553 ] [10.1016/j.bmc.2020.115740 ]