The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((S)-4-methyl-1-(((S)-1-(((S)-5-methyl-1,2-dioxo-1-(phenylamino)hexan-3-yl)amino)-1-oxo-3-phenylpropan-2-yl)amino)-1-oxopentan-2-yl)carbamic acid benzyl ester ID: ALA4742723
PubChem CID: 162645637
Max Phase: Preclinical
Molecular Formula: C36H44N4O6
Molecular Weight: 628.77
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)Nc1ccccc1
Standard InChI: InChI=1S/C36H44N4O6/c1-24(2)20-29(32(41)35(44)37-28-18-12-7-13-19-28)38-34(43)31(22-26-14-8-5-9-15-26)39-33(42)30(21-25(3)4)40-36(45)46-23-27-16-10-6-11-17-27/h5-19,24-25,29-31H,20-23H2,1-4H3,(H,37,44)(H,38,43)(H,39,42)(H,40,45)/t29-,30-,31-/m0/s1
Standard InChI Key: HUXZYRMNXVAVPZ-CHQNGUEUSA-N
Molfile:
RDKit 2D
46 48 0 0 0 0 0 0 0 0999 V2000
18.7021 -10.0854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4177 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1332 -10.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4177 -8.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1332 -10.9109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8488 -9.6747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5601 -10.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2756 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9911 -10.0854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2756 -8.8491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7067 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4222 -10.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1377 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4222 -10.9109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8533 -10.0854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1377 -8.8491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5688 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2793 -10.0890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9944 -9.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9948 -8.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2743 -8.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5663 -8.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9866 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7067 -8.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9911 -8.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9911 -7.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1622 -8.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5601 -10.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9866 -8.8491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2711 -10.0854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5555 -9.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8400 -10.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1293 -9.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4142 -10.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4138 -10.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1344 -11.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8423 -10.9060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2756 -11.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2698 -12.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9845 -12.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7025 -12.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7014 -11.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9861 -10.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1291 -8.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1291 -7.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8404 -8.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 1
3 5 2 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
13 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
1 23 1 0
11 24 1 1
24 25 1 0
25 26 1 0
25 27 1 0
7 28 1 6
23 29 2 0
23 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
28 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
4 44 1 0
44 45 1 0
44 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.77Molecular Weight (Monoisotopic): 628.3261AlogP: 4.79#Rotatable Bonds: 16Polar Surface Area: 142.70Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.50CX Basic pKa: ┄CX LogP: 6.40CX LogD: 6.40Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -0.34
References 1. Wang J,Liang B,Chen Y,Fuk-Woo Chan J,Yuan S,Ye H,Nie L,Zhou J,Wu Y,Wu M,Huang LS,An J,Warshel A,Yuen KY,Ciechanover A,Huang Z,Xu Y. (2021) A new class of α-ketoamide derivatives with potent anticancer and anti-SARS-CoV-2 activities., 215 [PMID:33639344 ] [10.1016/j.ejmech.2021.113267 ]