N-[(Z)-1-[[(1S)-1-benzyl-2-hydroxy-ethyl]carbamoyl]-2-bromo-2-phenyl-vinyl]-2-chloro-4-fluoro-benzamide

ID: ALA4742753

PubChem CID: 162645801

Max Phase: Preclinical

Molecular Formula: C25H21BrClFN2O3

Molecular Weight: 531.81

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H](CO)Cc1ccccc1)/C(NC(=O)c1ccc(F)cc1Cl)=C(/Br)c1ccccc1

Standard InChI:  InChI=1S/C25H21BrClFN2O3/c26-22(17-9-5-2-6-10-17)23(30-24(32)20-12-11-18(28)14-21(20)27)25(33)29-19(15-31)13-16-7-3-1-4-8-16/h1-12,14,19,31H,13,15H2,(H,29,33)(H,30,32)/b23-22-/t19-/m0/s1

Standard InChI Key:  NPJYSPXHWSLWNS-ZABCRHKISA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    1.1069   -9.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1058  -10.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8205  -10.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5370  -10.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5342   -9.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8187   -8.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8203  -11.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1058  -11.6649    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.5347  -11.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5345  -12.4903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2492  -11.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9637  -11.6656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2494  -10.4279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6782  -11.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3926  -11.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6784  -10.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3930  -10.0160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3924  -12.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2488  -12.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2486  -13.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9634  -12.4906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5351  -14.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5345  -14.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2494  -15.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9663  -14.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9634  -14.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6782  -12.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6776  -13.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3926  -14.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1095  -13.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1065  -12.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8211  -13.7245    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.2503  -16.2007    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  6
 14 15  1  0
 14 16  1  0
 16 17  1  0
 15 18  1  0
 10 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 18 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 18  1  0
 22 32  1  0
 24 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742753

    ---

Associated Targets(Human)

HepG2 2.2.15 (869 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.81Molecular Weight (Monoisotopic): 530.0408AlogP: 4.69#Rotatable Bonds: 8
Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.15CX Basic pKa: CX LogP: 4.52CX LogD: 4.52
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.89

References

1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J.  (2021)  Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents.,  29  [PMID:33285406] [10.1016/j.bmc.2020.115892]

Source