The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(Naphthalen-1-yl)-3-(2-(7-oxo-5-(propylthio)-6,7-dihydro-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)ethyl)thiourea ID: ALA4742820
PubChem CID: 162646555
Max Phase: Preclinical
Molecular Formula: C20H21N7OS2
Molecular Weight: 439.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCSc1nc2c(nnn2CCNC(=S)Nc2cccc3ccccc23)c(=O)[nH]1
Standard InChI: InChI=1S/C20H21N7OS2/c1-2-12-30-20-23-17-16(18(28)24-20)25-26-27(17)11-10-21-19(29)22-15-9-5-7-13-6-3-4-8-14(13)15/h3-9H,2,10-12H2,1H3,(H2,21,22,29)(H,23,24,28)
Standard InChI Key: JWOXNNPMBOVRNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
25.9093 -2.8931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9082 -3.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6204 -4.0721 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6186 -2.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3354 -2.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3357 -3.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1269 -3.9793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6189 -3.3049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1265 -2.6350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1960 -4.0712 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.4804 -3.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7641 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1188 -4.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8266 -5.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8185 -6.0451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5263 -6.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5182 -7.2819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2421 -6.0591 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.0518 -3.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6151 -1.6588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2218 -7.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6243 -8.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6297 -7.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9263 -7.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9116 -8.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2112 -8.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5045 -8.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4970 -9.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2021 -10.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9059 -9.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
2 10 1 0
10 11 1 0
11 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
12 19 1 0
4 20 2 0
17 21 1 0
21 26 2 0
25 22 2 0
22 23 1 0
23 24 2 0
24 21 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.57Molecular Weight (Monoisotopic): 439.1249AlogP: 3.16#Rotatable Bonds: 7Polar Surface Area: 100.52Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.47CX Basic pKa: ┄CX LogP: 4.25CX LogD: 4.03Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.23Np Likeness Score: -2.33
References 1. Li,ZH.; Ma,JL.; Liu,GZ.; Zhang,XH.; Qin,TT.; Ren,WH.; Zhao,TQ.; Chen,XH.; Zhang,ZQ.. (2020) [1,2,3]Triazolo[4,5-d]pyrimidine derivatives incorporating (thio)urea moiety as a novel scaffold for LSD1 inhibitors., 187 [PMID:31881456 ] [10.1016/j.ejmech.2019.111989 ]