N-(1,2,3,5,6,7-hexahydros-indacen-4-ylcarbamoyl)-2-(4-(2-hydroxypropan-2-yl)thiazol-2-yl)ethenesulfonamide

ID: ALA4742825

PubChem CID: 137537424

Max Phase: Preclinical

Molecular Formula: C21H25N3O4S2

Molecular Weight: 447.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(O)c1csc(/C=C/S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)n1

Standard InChI:  InChI=1S/C21H25N3O4S2/c1-21(2,26)17-12-29-18(22-17)9-10-30(27,28)24-20(25)23-19-15-7-3-5-13(15)11-14-6-4-8-16(14)19/h9-12,26H,3-8H2,1-2H3,(H2,23,24,25)/b10-9+

Standard InChI Key:  BYXBXRURHOGHOG-MDZDMXLPSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   41.6148  -18.8160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.0276  -19.5300    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.4401  -18.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.8769  -19.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3001  -18.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8781  -18.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5855  -18.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4113  -17.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5986  -17.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2692  -18.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3029  -19.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5942  -19.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7662  -20.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5813  -20.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.9103  -20.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1653  -19.9455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4533  -19.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7417  -19.9463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4528  -18.7119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.3180  -19.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6078  -19.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8985  -19.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1462  -19.6243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5989  -20.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0159  -20.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8183  -20.7736    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.7816  -20.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4447  -19.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3052  -20.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9841  -19.9428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  6  4  2  0
  4 12  1  0
 11  5  1  0
  5  7  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
  4 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18  2  1  0
  2 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742825

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.1286AlogP: 3.47#Rotatable Bonds: 5
Polar Surface Area: 108.39Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.64CX Basic pKa: 1.42CX LogP: 3.91CX LogD: 2.97
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -0.72

References

1. Agarwal S,Pethani JP,Shah HA,Vyas V,Sasane S,Bhavsar H,Bandyopadhyay D,Giri P,Viswanathan K,Jain MR,Sharma R.  (2020)  Identification of a novel orally bioavailable NLRP3 inflammasome inhibitor.,  30  (21.0): [PMID:32980515] [10.1016/j.bmcl.2020.127571]

Source