5-[3-(2-Aminopyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-[(1S)-1-cyclopropylethyl]-7-methyl-2,3-dihydro-1H-isoindol-1-one

ID: ALA4742917

PubChem CID: 162645657

Max Phase: Preclinical

Molecular Formula: C26H25N5O

Molecular Weight: 423.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3[nH]cc(-c4ccnc(N)c4)c3c2)cc2c1C(=O)N([C@@H](C)C1CC1)C2

Standard InChI:  InChI=1S/C26H25N5O/c1-14-7-18(8-20-13-31(26(32)24(14)20)15(2)16-3-4-16)19-9-21-22(12-30-25(21)29-11-19)17-5-6-28-23(27)10-17/h5-12,15-16H,3-4,13H2,1-2H3,(H2,27,28)(H,29,30)/t15-/m0/s1

Standard InChI Key:  VDWJMNIZTFKBIL-HNNXBMFYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   30.8744  -12.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8732  -13.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5813  -13.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5795  -12.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2881  -12.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2929  -13.3741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0729  -13.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5503  -12.9575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0652  -12.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3675  -12.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7802  -13.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3300  -14.3983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5823  -14.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7861  -14.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4914  -14.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7719  -12.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1686  -12.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1698  -11.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4628  -10.9242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4646  -12.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7571  -12.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7501  -11.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9710  -11.0915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4963  -11.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9822  -12.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7378  -13.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9386  -13.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6925  -14.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2447  -14.7473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0462  -14.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2884  -13.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8946  -14.3201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
  7 12  2  0
  3 13  1  0
 14 11  1  0
 15 14  1  0
 11 15  1  0
 10 16  1  1
 17 18  2  0
 18 19  1  0
 19 22  2  0
 21 20  2  0
 20 17  1  0
  1 17  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 26  1  0
 28 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742917

    ---

Associated Targets(Human)

PIK3CG Tclin PI3-kinase p110-gamma subunit (5411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.2059AlogP: 4.94#Rotatable Bonds: 4
Polar Surface Area: 87.90Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.37CX LogP: 3.82CX LogD: 3.79
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: 0.01

References

1. Miles DH,Yan X,Thomas-Tran R,Fournier J,Sharif EU,Drew SL,Mata G,Lawson KV,Ginn E,Wong K,Soni D,Dhanota P,Shaqfeh SG,Meleza C,Chen A,Pham AT,Park T,Swinarski D,Banuelos J,Schindler U,Walters MJ,Walker NP,Zhao X,Young SW,Chen J,Jin L,Leleti MR,Powers JP,Jeffrey JL.  (2020)  Discovery of Potent and Selective 7-Azaindole Isoindolinone-Based PI3Kγ Inhibitors.,  11  (11): [PMID:33214836] [10.1021/acsmedchemlett.0c00387]

Source