Lycosquarrine C

ID: ALA4742952

PubChem CID: 162646139

Max Phase: Preclinical

Molecular Formula: C25H33NO5

Molecular Weight: 427.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1C[C@@]23[C@H]4CCCN2CC[C@H]2O[C@]23[C@H](C[C@@H]4OC(=O)CCc2ccc(O)cc2)[C@@H]1O

Standard InChI:  InChI=1S/C25H33NO5/c1-15-14-24-18-3-2-11-26(24)12-10-21-25(24,31-21)19(23(15)29)13-20(18)30-22(28)9-6-16-4-7-17(27)8-5-16/h4-5,7-8,15,18-21,23,27,29H,2-3,6,9-14H2,1H3/t15-,18-,19+,20-,21+,23+,24-,25+/m0/s1

Standard InChI Key:  GULIPKAZXQFEMZ-SKVMYEKZSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   24.1979   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1979   -4.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8520   -4.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8555   -3.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1902   -3.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5142   -4.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8559   -4.8873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8513   -5.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5076   -6.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1783   -5.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1846   -4.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6602   -4.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6808   -2.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1926   -2.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8578   -3.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5147   -3.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5195   -2.9734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8435   -5.2746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.5104   -4.9066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1760   -4.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8344   -4.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1832   -3.7671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5082   -4.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1666   -4.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1562   -5.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8138   -6.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4803   -5.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4852   -4.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8270   -4.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1358   -6.1015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2380   -4.0158    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.7711   -1.9330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1108   -1.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8930   -2.9468    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1 15  1  0
  2  7  1  0
 16  6  1  0
 16  5  1  0
 11  3  1  0
  3  4  1  0
  4  5  1  0
  6  7  1  0
  6 11  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  6 12  1  1
 12 13  1  0
  5 14  1  0
 14 13  1  0
 16 15  1  0
 16 17  1  1
 15 17  1  0
 11 18  1  1
  3 19  1  6
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 15 31  1  6
 14 32  1  1
 13 33  1  6
  5 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4742952

    ---

Associated Targets(non-human)

ACHE Acetylcholinesterase (1035 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.54Molecular Weight (Monoisotopic): 427.2359AlogP: 2.65#Rotatable Bonds: 4
Polar Surface Area: 82.53Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.69CX Basic pKa: 9.05CX LogP: 1.84CX LogD: 0.56
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: 1.81

References

1. Zhu X,Xia D,Zhou Z,Xie S,Shi Z,Chen G,Wang L,Pan K.  (2020)  Lycosquarrines A-R, Lycopodium Alkaloids from Phlegmariurus squarrosus.,  83  (10): [PMID:32941036] [10.1021/acs.jnatprod.9b00815]

Source