The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-bromo-N-(3-chloro-4-methoxyphenyl)-2,2-difluoro-N-(2-oxo-2-(phenethylamino)-1-(thiophen-2-yl)ethyl)acetamide ID: ALA4742976
PubChem CID: 162646278
Max Phase: Preclinical
Molecular Formula: C23H20BrClF2N2O3S
Molecular Weight: 557.84
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N(C(=O)C(F)(F)Br)C(C(=O)NCCc2ccccc2)c2cccs2)cc1Cl
Standard InChI: InChI=1S/C23H20BrClF2N2O3S/c1-32-18-10-9-16(14-17(18)25)29(22(31)23(24,26)27)20(19-8-5-13-33-19)21(30)28-12-11-15-6-3-2-4-7-15/h2-10,13-14,20H,11-12H2,1H3,(H,28,30)
Standard InChI Key: NGERKAWALMXUOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
45.1992 -15.3207 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.7929 -14.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3779 -15.3181 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.6560 -15.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6549 -16.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3703 -17.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0874 -16.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0846 -15.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3685 -15.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3661 -14.6155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.0800 -14.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0776 -13.3778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6498 -14.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6473 -13.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8032 -17.0919 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.3701 -17.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6549 -18.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9358 -14.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9383 -15.4449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2195 -14.2114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5097 -14.6240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7934 -14.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0795 -14.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3638 -14.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6504 -14.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6524 -15.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3737 -15.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0842 -15.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3137 -12.8969 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.0576 -12.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2325 -12.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9771 -12.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5103 -14.1986 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 2 1 0
10 13 1 0
13 14 1 0
7 15 1 0
6 16 1 0
16 17 1 0
13 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 14 2 0
2 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.84Molecular Weight (Monoisotopic): 556.0035AlogP: 5.83#Rotatable Bonds: 9Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.77CX LogD: 5.77Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.48
References 1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL. (2020) Structure-activity relationships of GPX4 inhibitor warheads., 30 (23.0): [PMID:32920142 ] [10.1016/j.bmcl.2020.127538 ]