2-bromo-N-(3-chloro-4-methoxyphenyl)-2,2-difluoro-N-(2-oxo-2-(phenethylamino)-1-(thiophen-2-yl)ethyl)acetamide

ID: ALA4742976

PubChem CID: 162646278

Max Phase: Preclinical

Molecular Formula: C23H20BrClF2N2O3S

Molecular Weight: 557.84

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N(C(=O)C(F)(F)Br)C(C(=O)NCCc2ccccc2)c2cccs2)cc1Cl

Standard InChI:  InChI=1S/C23H20BrClF2N2O3S/c1-32-18-10-9-16(14-17(18)25)29(22(31)23(24,26)27)20(19-8-5-13-33-19)21(30)28-12-11-15-6-3-2-4-7-15/h2-10,13-14,20H,11-12H2,1H3,(H,28,30)

Standard InChI Key:  NGERKAWALMXUOL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   45.1992  -15.3207    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   44.7929  -14.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3779  -15.3181    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   42.6560  -15.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6549  -16.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3703  -17.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0874  -16.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0846  -15.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3685  -15.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3661  -14.6155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.0800  -14.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0776  -13.3778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6498  -14.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6473  -13.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8032  -17.0919    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   43.3701  -17.9190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6549  -18.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9358  -14.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9383  -15.4449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2195  -14.2114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.5097  -14.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7934  -14.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0795  -14.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3638  -14.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6504  -14.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6524  -15.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3737  -15.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0842  -15.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3137  -12.8969    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.0576  -12.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2325  -12.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9771  -12.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5103  -14.1986    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11  2  1  0
 10 13  1  0
 13 14  1  0
  7 15  1  0
  6 16  1  0
 16 17  1  0
 13 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 14  2  0
  2 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4742976

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 557.84Molecular Weight (Monoisotopic): 556.0035AlogP: 5.83#Rotatable Bonds: 9
Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.77CX LogD: 5.77
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.48

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source