The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-allyl-tabernaemontanine ID: ALA4742984
PubChem CID: 162646408
Max Phase: Preclinical
Molecular Formula: C24H30N2O3
Molecular Weight: 394.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCn1c2c(c3ccccc31)C[C@H]1C(C(=O)OC)[C@H](CC2=O)[C@H](CC)CN1C
Standard InChI: InChI=1S/C24H30N2O3/c1-5-11-26-19-10-8-7-9-16(19)18-12-20-22(24(28)29-4)17(13-21(27)23(18)26)15(6-2)14-25(20)3/h5,7-10,15,17,20,22H,1,6,11-14H2,2-4H3/t15-,17-,20+,22?/m1/s1
Standard InChI Key: SLPISKNXJKWBMN-LBXXQKFWSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
8.9324 -7.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9313 -8.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6451 -9.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6434 -7.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3578 -7.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3580 -8.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1474 -8.9844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1490 -7.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6389 -8.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4782 -6.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7935 -7.4649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4580 -8.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9437 -8.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7670 -8.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1024 -8.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6145 -7.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0380 -8.9339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1990 -6.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2517 -9.4682 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.3807 -5.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1766 -5.7225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1675 -4.7135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7591 -5.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3073 -6.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7982 -6.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3002 -5.9753 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.9217 -7.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4067 -8.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4012 -9.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8492 -10.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1029 -11.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 10 1 0
9 12 1 0
11 24 1 0
24 10 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
12 17 2 0
11 18 1 0
14 19 1 6
25 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
14 25 1 0
25 24 1 0
24 26 1 6
15 27 1 1
27 28 1 0
7 29 1 0
29 30 1 0
30 31 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.52Molecular Weight (Monoisotopic): 394.2256AlogP: 3.70#Rotatable Bonds: 4Polar Surface Area: 51.54Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.60CX LogP: 3.61CX LogD: 3.20Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: 0.71
References 1. Cardoso DSP,Kincses A,Nové M,Spengler G,Mulhovo S,Aires-de-Sousa J,Dos Santos DJVA,Ferreira MU. (2021) Alkylated monoterpene indole alkaloid derivatives as potent P-glycoprotein inhibitors in resistant cancer cells., 210 [PMID:33189435 ] [10.1016/j.ejmech.2020.112985 ]