1-benzyl-3-(5-bromopentyloxy)-5-nitro-1H-indazole

ID: ALA4743080

PubChem CID: 162647185

Max Phase: Preclinical

Molecular Formula: C19H20BrN3O3

Molecular Weight: 418.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc2c(c1)c(OCCCCCBr)nn2Cc1ccccc1

Standard InChI:  InChI=1S/C19H20BrN3O3/c20-11-5-2-6-12-26-19-17-13-16(23(24)25)9-10-18(17)22(21-19)14-15-7-3-1-4-8-15/h1,3-4,7-10,13H,2,5-6,11-12,14H2

Standard InChI Key:  HYAIGRYNUQZUJT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   15.8737  -17.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3552  -19.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9245  -19.0201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0086  -22.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2877  -21.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6252  -17.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8199  -17.9668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1965  -22.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6371  -17.7832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5752  -20.0969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9347  -21.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5500  -22.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6373  -18.6076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4838  -21.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0673  -20.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8372  -20.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5672  -18.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0602  -19.4236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6790  -16.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0654  -18.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7843  -19.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7792  -19.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3540  -19.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9276  -16.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7332  -15.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9817  -15.0787    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
 17 22  1  0
  6  1  1  0
 17  7  1  0
  7  6  1  0
  4 12  2  0
 20  2  1  0
 12  5  1  0
 10 16  1  0
  2 13  1  0
 22 20  2  0
  1 19  1  0
 21 10  1  0
 15 21  2  0
 11  8  2  0
 13  9  1  0
 22 21  1  0
 16  5  1  0
  2 23  2  0
  5 14  2  0
  8  4  1  0
 10 18  1  0
 18 17  2  0
 23 15  1  0
 13  3  2  0
 14 11  1  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
M  CHG  2   9  -1  13   1
M  END

Alternative Forms

  1. Parent:

    ALA4743080

    ---

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.29Molecular Weight (Monoisotopic): 417.0688AlogP: 4.94#Rotatable Bonds: 9
Polar Surface Area: 70.19Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.39CX LogD: 5.39
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.21Np Likeness Score: -1.40

References

1. Ibáñez-Escribano A,Reviriego F,Vela N,Fonseca-Berzal C,Nogal-Ruiz JJ,Arán VJ,Escario JA,Gómez-Barrio A.  (2021)  Promising hit compounds against resistant trichomoniasis: Synthesis and antiparasitic activity of 3-(ω-aminoalkoxy)-1-benzyl-5-nitroindazoles.,  37  [PMID:33556576] [10.1016/j.bmcl.2021.127843]

Source