The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-ethylbutyl((2-((4-(2-amino-4-methoxypyrimidin-5-yl)-1H-imidazol-1-yl)methoxy)ethoxy)-(phenoxy)-phosphoryl)alaninate ID: ALA4743114
PubChem CID: 162645235
Max Phase: Preclinical
Molecular Formula: C27H38N5O8P
Molecular Weight: 591.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)COC(=O)[C@H](C)NP(=O)(OCCOCn1cc(-c2cnc(OC)nc2OC)cn1)Oc1ccccc1
Standard InChI: InChI=1S/C27H38N5O8P/c1-6-21(7-2)18-38-26(33)20(3)31-41(34,40-23-11-9-8-10-12-23)39-14-13-37-19-32-17-22(15-29-32)24-16-28-27(36-5)30-25(24)35-4/h8-12,15-17,20-21H,6-7,13-14,18-19H2,1-5H3,(H,31,34)/t20-,41?/m0/s1
Standard InChI Key: HIMCULKYRZYPRH-ULHAEWICSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
26.5354 -9.1644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0641 -9.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4175 -10.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2419 -10.6575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7116 -9.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3557 -9.2294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2399 -9.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8112 -9.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0083 -9.2625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9409 -10.0847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7020 -10.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2361 -10.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5124 -10.1175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8076 -10.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0839 -10.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3791 -10.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5342 -10.0363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1819 -8.4189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6507 -7.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6553 -10.1833 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
18.9506 -10.6121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2269 -10.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5220 -10.6449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7983 -10.2490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0935 -10.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3698 -10.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6650 -10.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5410 -11.4697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9412 -10.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3508 -9.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6271 -9.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8051 -10.9915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5828 -11.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7300 -12.0785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5067 -12.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1350 -11.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9813 -11.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2045 -10.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8902 -10.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6494 -9.3581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2079 -9.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
2 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
1 18 1 0
18 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
23 28 2 0
27 29 1 0
26 30 1 0
30 31 1 0
20 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
17 39 1 0
20 40 2 0
22 41 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 591.60Molecular Weight (Monoisotopic): 591.2458AlogP: 4.49#Rotatable Bonds: 18Polar Surface Area: 145.15Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.24CX Basic pKa: 2.97CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.13Np Likeness Score: -0.60
References 1. Thames JE,Waters CD,Valle C,Bassetto M,Aouadi W,Martin B,Selisko B,Falat A,Coutard B,Brancale A,Canard B,Decroly E,Seley-Radtke KL. (2020) Synthesis and biological evaluation of novel flexible nucleoside analogues that inhibit flavivirus replication in vitro., 28 (22): [PMID:33128910 ] [10.1016/j.bmc.2020.115713 ]