Lycosquarrine N

ID: ALA4743265

PubChem CID: 162647334

Max Phase: Preclinical

Molecular Formula: C16H22N2O

Molecular Weight: 258.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1C[C@@]23NCCC[C@@H]2[C@H](Cc2ncccc23)[C@@H]1O

Standard InChI:  InChI=1S/C16H22N2O/c1-10-9-16-12(4-3-7-18-16)11(15(10)19)8-14-13(16)5-2-6-17-14/h2,5-6,10-12,15,18-19H,3-4,7-9H2,1H3/t10-,11-,12+,15+,16+/m0/s1

Standard InChI Key:  IZSWVBHUBNPZTL-YYFFNPIBSA-N

Molfile:  

 
     RDKit          2D

 21 24  0  0  0  0  0  0  0  0999 V2000
   31.8746  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8746  -21.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5510  -22.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5510  -20.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2274  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2239  -21.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5775  -20.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8999  -20.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5741  -21.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8935  -22.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8877  -22.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5607  -23.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2371  -22.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2446  -22.1608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5391  -21.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9022  -19.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1210  -19.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3274  -20.2028    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.5738  -20.1987    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.6553  -19.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4812  -19.2347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  6 15  1  1
  8 16  1  0
 16 17  1  0
 17 15  1  0
  5 18  1  1
  8 19  1  6
 17 20  1  6
 16 21  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4743265

    ---

Associated Targets(non-human)

ACHE Acetylcholinesterase (1035 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 258.37Molecular Weight (Monoisotopic): 258.1732AlogP: 1.85#Rotatable Bonds:
Polar Surface Area: 45.15Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.11CX LogP: 1.20CX LogD: -0.52
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.75Np Likeness Score: 1.52

References

1. Zhu X,Xia D,Zhou Z,Xie S,Shi Z,Chen G,Wang L,Pan K.  (2020)  Lycosquarrines A-R, Lycopodium Alkaloids from Phlegmariurus squarrosus.,  83  (10): [PMID:32941036] [10.1021/acs.jnatprod.9b00815]

Source