The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-cyclohexyl-N-(5-(N,N-dimethylsulfamoyl)-2-methylphenyl)-2-(3-(2-(4-(trifluoromethyl)phenyl)acetyl)guanidino)propanamide Trifluoroacetic acid ID: ALA4743293
PubChem CID: 162645390
Max Phase: Preclinical
Molecular Formula: C30H37F6N5O6S
Molecular Weight: 595.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)[C@@H](CC1CCCCC1)NC(=N)NC(=O)Cc1ccc(C(F)(F)F)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C28H36F3N5O4S.C2HF3O2/c1-18-9-14-22(41(39,40)36(2)3)17-23(18)33-26(38)24(15-19-7-5-4-6-8-19)34-27(32)35-25(37)16-20-10-12-21(13-11-20)28(29,30)31;3-2(4,5)1(6)7/h9-14,17,19,24H,4-8,15-16H2,1-3H3,(H,33,38)(H3,32,34,35,37);(H,6,7)/t24-;/m1./s1
Standard InChI Key: DAVZGJAQWZVCGH-GJFSDDNBSA-N
Molfile:
RDKit 2D
48 49 0 0 0 0 0 0 0 0999 V2000
17.2229 -22.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9348 -22.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6466 -22.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9348 -21.6927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5111 -22.5140 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.2229 -23.7439 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5089 -23.3312 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5750 -20.8219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1664 -20.1161 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.7574 -20.8193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8831 -18.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8819 -19.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5941 -20.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3079 -19.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3051 -18.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5923 -18.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0154 -18.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0204 -20.1168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7316 -19.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4440 -20.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7303 -18.8817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1511 -19.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1498 -18.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8610 -18.4698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4415 -18.4720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4583 -19.7046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7502 -20.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4589 -18.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4453 -20.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1537 -21.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1512 -22.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8596 -22.5755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5732 -22.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5739 -21.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8610 -20.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5683 -18.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2764 -18.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5676 -19.6962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9837 -18.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9798 -19.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6863 -20.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3954 -19.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3935 -18.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6864 -18.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1032 -20.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1035 -20.9229 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.8108 -19.6969 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.8063 -20.5123 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 8 2 0
10 9 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
12 9 1 0
9 26 1 0
26 27 1 0
26 28 1 0
20 29 1 6
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
24 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
42 45 1 0
45 46 1 0
45 47 1 0
45 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.69Molecular Weight (Monoisotopic): 595.2440AlogP: 4.42#Rotatable Bonds: 9Polar Surface Area: 131.46Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.51CX Basic pKa: 7.99CX LogP: 4.86CX LogD: 4.17Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.25Np Likeness Score: -1.27
References 1. Goyal S,Patel KV,Nagare Y,Raykar DB,Raikar SS,Dolas A,Khurana P,Cyriac R,Sarak S,Gangar M,Agarwal AK,Kulkarni A. (2021) Identification and structure-activity relationship studies of small molecule inhibitors of the human cathepsin D., 29 [PMID:33271453 ] [10.1016/j.bmc.2020.115879 ]