1-((4aR,4bR,6aR,6bS,8aS,12aS,14aR,14bR,16aS)-2,2,4a,6a,6b,11,11,14b-octamethyl-4a,4b,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b,15,16,16a-icosahydro-4H-piceno[3,4-d][1,3]dioxin-8a-yl)-3-(pyridin-3-ylmethyl)urea

ID: ALA4743307

PubChem CID: 162645675

Max Phase: Preclinical

Molecular Formula: C39H59N3O3

Molecular Weight: 617.92

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CC[C@]2(NC(=O)NCc3cccnc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H]6OC(C)(C)OC[C@@]6(C)[C@@H]5CC[C@]43C)[C@@H]2C1

Standard InChI:  InChI=1S/C39H59N3O3/c1-33(2)17-19-39(42-32(43)41-24-26-10-9-21-40-23-26)20-18-37(7)27(28(39)22-33)11-12-30-35(5)15-14-31-36(6,25-44-34(3,4)45-31)29(35)13-16-38(30,37)8/h9-11,21,23,28-31H,12-20,22,24-25H2,1-8H3,(H2,41,42,43)/t28-,29+,30+,31-,35-,36-,37+,38+,39-/m0/s1

Standard InChI Key:  HFHRFLAZQIJTSD-KRAILMGQSA-N

Molfile:  

 
     RDKit          2D

 49 55  0  0  0  0  0  0  0  0999 V2000
   40.9789  -14.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3968  -15.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8102  -14.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3616  -18.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0757  -17.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7897  -18.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7861  -18.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4970  -19.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2158  -18.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5040  -17.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2154  -18.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2324  -16.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5094  -16.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9439  -16.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9300  -17.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6323  -18.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3531  -17.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6601  -16.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3626  -16.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0805  -16.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1023  -15.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6755  -15.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6529  -17.2616    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.0737  -17.2783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2072  -17.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7823  -17.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4969  -18.4733    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.9217  -18.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7914  -16.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9954  -19.6809    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.0720  -19.2964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3616  -18.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6557  -19.2951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6540  -20.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3643  -20.5240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0765  -20.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0678  -18.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6430  -18.4733    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.5047  -17.2813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7939  -16.0416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2205  -16.8710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9337  -17.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8570  -19.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2414  -20.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6483  -16.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9337  -18.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6483  -18.5232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.3628  -18.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3628  -17.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4 32  1  0
  4  5  1  0
 31  7  1  0
  6  5  1  0
  6  7  1  0
  6 10  1  0
  7  8  1  0
  8  9  1  0
  9 11  1  0
 10 11  1  0
 10 13  1  0
 11 15  1  0
 14 12  2  0
 12 13  1  0
 14 15  1  0
 14 18  1  0
 15 16  1  0
 16 17  1  0
 17 19  1  0
 18 19  1  0
 18 22  1  0
 19 20  1  0
 20 21  1  0
 21  2  1  0
  2 22  1  0
 18 23  1  1
 19 24  1  1
 11 25  1  1
  6 26  1  1
 10 27  1  6
 15 28  1  6
 24 29  1  0
  7 30  1  6
 31 32  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 31 37  1  1
 32 38  1  6
 29 39  1  0
 29 40  2  0
 39 41  1  0
 41 42  1  0
 34 43  1  0
 34 44  1  0
 45 42  2  0
 42 46  1  0
 46 47  2  0
 47 48  1  0
 48 49  2  0
 45 49  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743307

    ---

Associated Targets(non-human)

Leishmania mexicana (936 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 617.92Molecular Weight (Monoisotopic): 617.4556AlogP: 8.57#Rotatable Bonds: 3
Polar Surface Area: 72.48Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.82CX LogP: 6.40CX LogD: 6.40
Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.33Np Likeness Score: 1.62

References

1. Anderson, Orlagh, Beckett, Joseph, Briggs, Carla C., Natrass, Liam A., Cranston, Charles F., Wilkinson, Elizabeth J., Owen, Jack H., Mir Williams, Rhodri, Loukaidis, Angelos, Bouillon, Marc E., Pritchard, Deiniol, Lahmann, Martina, Baird, Mark S., Denny, Paul W..  (2020)  An investigation of the antileishmanial properties of semi-synthetic saponins,  11  (7): [PMID:33479679] [10.1039/d0md00123f]

Source