3-(4-((2-bromo-5-fluorophenoxy)methyl)phenyl)propanoic acid

ID: ALA4743323

PubChem CID: 162645828

Max Phase: Preclinical

Molecular Formula: C16H14BrFO3

Molecular Weight: 353.19

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CCc1ccc(COc2cc(F)ccc2Br)cc1

Standard InChI:  InChI=1S/C16H14BrFO3/c17-14-7-6-13(18)9-15(14)21-10-12-3-1-11(2-4-12)5-8-16(19)20/h1-4,6-7,9H,5,8,10H2,(H,19,20)

Standard InChI Key:  FROMBFNPGOZGFH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    6.8085  -19.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8074  -19.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5154  -20.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2251  -19.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2222  -19.1550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5136  -18.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9284  -18.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6376  -19.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3438  -18.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0531  -19.1443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3407  -17.9212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0993  -20.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3919  -19.9770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6839  -20.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9773  -19.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2697  -20.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2687  -21.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9810  -21.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6856  -21.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9832  -22.4253    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792  -19.1565    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 15 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743323

    ---

Associated Targets(Human)

FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.19Molecular Weight (Monoisotopic): 352.0110AlogP: 4.18#Rotatable Bonds: 6
Polar Surface Area: 46.53Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.16CX Basic pKa: CX LogP: 4.53CX LogD: 1.47
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.85Np Likeness Score: -0.68

References

1. Xu F,Zhao Y,Zhou H,Li C,Zhang X,Hou T,Qu L,Wei L,Wang J,Liu Y,Liang X.  (2020)  Synthesis and evaluation of 3-(4-(phenoxymethyl)phenyl)propanoic acid and N-phenylbenzenesulfonamide derivatives as FFA4 agonists.,  30  (24): [PMID:33127539] [10.1016/j.bmcl.2020.127650]

Source