The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(4-hydroxyphenethoxy)tetrahydro-2H-pyran-2-yl)methyl acetate ID: ALA4743378
PubChem CID: 101844777
Max Phase: Preclinical
Molecular Formula: C16H22O8
Molecular Weight: 342.34
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@H]1O[C@@H](OCCc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O
Standard InChI: InChI=1S/C16H22O8/c1-9(17)23-8-12-13(19)14(20)15(21)16(24-12)22-7-6-10-2-4-11(18)5-3-10/h2-5,12-16,18-21H,6-8H2,1H3/t12-,13-,14+,15-,16-/m1/s1
Standard InChI Key: KYMAFSUPPGDNQZ-IBEHDNSVSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
27.7185 -8.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7185 -8.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4237 -9.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1290 -8.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1290 -8.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4237 -7.6230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0096 -7.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0072 -6.8120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0114 -9.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8361 -9.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4237 -10.0746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8379 -7.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5444 -8.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2533 -7.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9598 -8.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9561 -8.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6618 -9.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3717 -8.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3714 -8.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6652 -7.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0770 -9.2772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7137 -6.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4226 -6.8079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7113 -5.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 1
7 8 1 0
2 9 1 6
4 10 1 6
3 11 1 1
5 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
8 22 1 0
22 23 2 0
22 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 342.34Molecular Weight (Monoisotopic): 342.1315AlogP: -0.68#Rotatable Bonds: 6Polar Surface Area: 125.68Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.20CX Basic pKa: ┄CX LogP: -0.14CX LogD: -0.14Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.50Np Likeness Score: 1.86
References 1. Yang Z,Huang X,Lai W,Tang Y,Liu J,Wang Y,Chu K,Brown J,Hong G. (2021) Synthesis and identification of a novel derivative of salidroside as a selective, competitive inhibitor of monoamine oxidase B with enhanced neuroprotective properties., 209 [PMID:33097301 ] [10.1016/j.ejmech.2020.112935 ]