The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-cyano-6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methyl-quinoline-4-carboxamide ID: ALA4743387
PubChem CID: 162646606
Max Phase: Preclinical
Molecular Formula: C24H15F2N3O
Molecular Weight: 399.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(-c2ccc(-c3ccccc3F)cc2)nc2ccc(F)cc2c1C(=O)NC#N
Standard InChI: InChI=1S/C24H15F2N3O/c1-14-22(24(30)28-13-27)19-12-17(25)10-11-21(19)29-23(14)16-8-6-15(7-9-16)18-4-2-3-5-20(18)26/h2-12H,1H3,(H,28,30)
Standard InChI Key: GNLUODHDGXUZKH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.0734 -22.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0722 -23.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7803 -23.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7785 -21.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4871 -22.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4879 -23.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1964 -23.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9047 -23.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8999 -22.2518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1908 -21.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6139 -23.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6051 -21.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3162 -22.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0209 -21.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0164 -21.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3012 -20.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5994 -21.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7190 -20.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4300 -21.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1342 -20.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1286 -19.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4129 -19.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7116 -19.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9998 -19.3901 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.3642 -23.4898 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1981 -24.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4912 -24.7120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9066 -24.7090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4929 -25.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4971 -26.3481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
23 24 1 0
2 25 1 0
7 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.40Molecular Weight (Monoisotopic): 399.1183AlogP: 5.37#Rotatable Bonds: 3Polar Surface Area: 65.78Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.62CX Basic pKa: 1.36CX LogP: 5.66CX LogD: 5.66Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -1.17
References 1. DeRatt LG,Christine Pietsch E,Tanner A,Shaffer P,Jacoby E,Wang W,Kazmi F,Zhang X,Attar RM,Edwards JP,Kuduk SD. (2020) A carboxylic acid isostere screen of the DHODH inhibitor Brequinar., 30 (22): [PMID:33007394 ] [10.1016/j.bmcl.2020.127589 ]