(E)-1-(3-(benzo[d][1,3]dioxol-5-yl)acryloyl)-3-pivaloylimidazolidin-2-one

ID: ALA4743392

PubChem CID: 162646610

Max Phase: Preclinical

Molecular Formula: C18H20N2O5

Molecular Weight: 344.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C(=O)N1CCN(C(=O)/C=C/c2ccc3c(c2)OCO3)C1=O

Standard InChI:  InChI=1S/C18H20N2O5/c1-18(2,3)16(22)20-9-8-19(17(20)23)15(21)7-5-12-4-6-13-14(10-12)25-11-24-13/h4-7,10H,8-9,11H2,1-3H3/b7-5+

Standard InChI Key:  CDMHVRIRARZRIO-FNORWQNLSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    8.8928  -21.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9622  -20.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2531  -21.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7746  -21.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4910  -20.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4882  -20.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7728  -19.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2011  -19.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9171  -20.1568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6299  -19.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3459  -20.1515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6268  -18.9168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4377  -20.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2452  -21.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6551  -20.4234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1006  -19.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2692  -19.0049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4751  -20.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7828  -20.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8078  -19.5789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0599  -20.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0565  -20.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2715  -19.9173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7896  -20.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2769  -21.2510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 21  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7 22  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
 16 17  2  0
 15 18  1  0
 18  2  1  0
  2 19  1  0
 18 20  2  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743392

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.37Molecular Weight (Monoisotopic): 344.1372AlogP: 2.27#Rotatable Bonds: 2
Polar Surface Area: 76.15Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.67CX LogD: 2.67
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.77Np Likeness Score: -0.38

References

1. Ji L,Qu L,Wang C,Peng W,Li S,Yang H,Luo H,Yin F,Lu D,Liu X,Kong L,Wang X.  (2021)  Identification and optimization of piperlongumine analogues as potential antioxidant and anti-inflammatory agents via activation of Nrf2.,  210  [PMID:33148493] [10.1016/j.ejmech.2020.112965]

Source