2-((4-(N-(carboxymethyl)-2,4,6-trimethylphenylsulfonamido)naphthalen-1-yl)oxy)-2-(4-(trifluoromethyl)phenyl)acetic acid

ID: ALA4743402

PubChem CID: 162646618

Max Phase: Preclinical

Molecular Formula: C30H26F3NO7S

Molecular Weight: 601.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(S(=O)(=O)N(CC(=O)O)c2ccc(OC(C(=O)O)c3ccc(C(F)(F)F)cc3)c3ccccc23)c(C)c1

Standard InChI:  InChI=1S/C30H26F3NO7S/c1-17-14-18(2)28(19(3)15-17)42(39,40)34(16-26(35)36)24-12-13-25(23-7-5-4-6-22(23)24)41-27(29(37)38)20-8-10-21(11-9-20)30(31,32)33/h4-15,27H,16H2,1-3H3,(H,35,36)(H,37,38)

Standard InChI Key:  ANNDFSSGOVBBKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   35.7831  -17.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1958  -16.8845    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.3782  -16.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7952  -18.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7941  -19.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5021  -19.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5004  -18.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2090  -18.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2097  -19.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9183  -19.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6265  -19.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6218  -18.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9127  -18.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9084  -17.2920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6139  -16.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3238  -17.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0293  -16.8721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3281  -18.1016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9200  -20.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6285  -20.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6302  -21.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3354  -20.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9234  -22.1970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3388  -22.1941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.0409  -20.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7473  -20.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7461  -19.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0325  -19.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3291  -19.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1942  -16.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9000  -15.6665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8988  -14.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1920  -14.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4850  -14.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4898  -15.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6072  -16.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7851  -16.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1892  -13.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4524  -19.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1615  -19.7380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.4496  -18.5146    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.1567  -18.9151    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 22 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 22  1  0
 14  2  1  0
  2 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 31 36  1  0
 35 37  1  0
 33 38  1  0
 27 39  1  0
 39 40  1  0
 39 41  1  0
 39 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743402

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 601.60Molecular Weight (Monoisotopic): 601.1382AlogP: 6.27#Rotatable Bonds: 9
Polar Surface Area: 121.21Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.27CX Basic pKa: CX LogP: 6.83CX LogD: 0.13
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -1.01

References

1. Lu MC,Shao HL,Liu T,You QD,Jiang ZY.  (2020)  Discovery of 2-oxy-2-phenylacetic acid substituted naphthalene sulfonamide derivatives as potent KEAP1-NRF2 protein-protein interaction inhibitors for inflammatory conditions.,  207  [PMID:32866756] [10.1016/j.ejmech.2020.112734]

Source