The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(N-(carboxymethyl)-2,4,6-trimethylphenylsulfonamido)naphthalen-1-yl)oxy)-2-(4-(trifluoromethyl)phenyl)acetic acid ID: ALA4743402
PubChem CID: 162646618
Max Phase: Preclinical
Molecular Formula: C30H26F3NO7S
Molecular Weight: 601.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(S(=O)(=O)N(CC(=O)O)c2ccc(OC(C(=O)O)c3ccc(C(F)(F)F)cc3)c3ccccc23)c(C)c1
Standard InChI: InChI=1S/C30H26F3NO7S/c1-17-14-18(2)28(19(3)15-17)42(39,40)34(16-26(35)36)24-12-13-25(23-7-5-4-6-22(23)24)41-27(29(37)38)20-8-10-21(11-9-20)30(31,32)33/h4-15,27H,16H2,1-3H3,(H,35,36)(H,37,38)
Standard InChI Key: ANNDFSSGOVBBKS-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
35.7831 -17.5902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1958 -16.8845 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.3782 -16.8799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7952 -18.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7941 -19.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5021 -19.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5004 -18.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2090 -18.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2097 -19.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9183 -19.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6265 -19.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6218 -18.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9127 -18.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9084 -17.2920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6139 -16.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3238 -17.2844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0293 -16.8721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3281 -18.1016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9200 -20.5626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6285 -20.9698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6302 -21.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3354 -20.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9234 -22.1970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3388 -22.1941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0409 -20.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7473 -20.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7461 -19.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0325 -19.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3291 -19.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1942 -16.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9000 -15.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8988 -14.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1920 -14.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4850 -14.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4898 -15.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6072 -16.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7851 -16.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1892 -13.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4524 -19.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1615 -19.7380 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.4496 -18.5146 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.1567 -18.9151 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
10 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
21 23 2 0
21 24 1 0
22 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 22 1 0
14 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
31 36 1 0
35 37 1 0
33 38 1 0
27 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.60Molecular Weight (Monoisotopic): 601.1382AlogP: 6.27#Rotatable Bonds: 9Polar Surface Area: 121.21Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.27CX Basic pKa: ┄CX LogP: 6.83CX LogD: 0.13Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -1.01
References 1. Lu MC,Shao HL,Liu T,You QD,Jiang ZY. (2020) Discovery of 2-oxy-2-phenylacetic acid substituted naphthalene sulfonamide derivatives as potent KEAP1-NRF2 protein-protein interaction inhibitors for inflammatory conditions., 207 [PMID:32866756 ] [10.1016/j.ejmech.2020.112734 ]