(3-amino-4-chlorophenyl)(4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl)methanone

ID: ALA4743448

PubChem CID: 162645398

Max Phase: Preclinical

Molecular Formula: C21H23ClN6O3

Molecular Weight: 442.91

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2nc(N3CCN(C(=O)c4ccc(Cl)c(N)c4)CC3)nc(N)c2cc1OC

Standard InChI:  InChI=1S/C21H23ClN6O3/c1-30-17-10-13-16(11-18(17)31-2)25-21(26-19(13)24)28-7-5-27(6-8-28)20(29)12-3-4-14(22)15(23)9-12/h3-4,9-11H,5-8,23H2,1-2H3,(H2,24,25,26)

Standard InChI Key:  IIGMSCPNSBFJIP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    3.3540  -28.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3529  -28.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0609  -29.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0591  -27.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7678  -28.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7685  -28.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4770  -29.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1853  -28.8561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1806  -28.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4715  -27.6306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8872  -27.6239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5973  -28.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3004  -27.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2996  -26.8034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5896  -26.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8803  -26.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0064  -26.3932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0045  -25.5760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6462  -27.6361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6448  -29.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4787  -30.0841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9386  -28.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9375  -28.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7141  -26.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7146  -27.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4224  -28.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1302  -27.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1257  -26.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4173  -26.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8394  -28.0190    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.8310  -26.3788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  9 11  1  0
 14 17  1  0
 17 18  2  0
  1 19  1  0
  2 20  1  0
  7 21  1  0
 19 22  1  0
 20 23  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 17 24  1  0
 27 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743448

    ---

Associated Targets(Human)

U-251 (51189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.91Molecular Weight (Monoisotopic): 442.1520AlogP: 2.43#Rotatable Bonds: 4
Polar Surface Area: 119.83Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.24CX LogP: 2.37CX LogD: 2.14
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -1.29

References

1. Orahoske CM,Li Y,Petty A,Salem FM,Hanna J,Zhang W,Su B,Wang B.  (2020)  Dimeric small molecule agonists of EphA2 receptor inhibit glioblastoma cell growth.,  28  (18): [PMID:32828423] [10.1016/j.bmc.2020.115656]

Source