The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-amino-4-chlorophenyl)(4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl)methanone ID: ALA4743448
PubChem CID: 162645398
Max Phase: Preclinical
Molecular Formula: C21H23ClN6O3
Molecular Weight: 442.91
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nc(N3CCN(C(=O)c4ccc(Cl)c(N)c4)CC3)nc(N)c2cc1OC
Standard InChI: InChI=1S/C21H23ClN6O3/c1-30-17-10-13-16(11-18(17)31-2)25-21(26-19(13)24)28-7-5-27(6-8-28)20(29)12-3-4-14(22)15(23)9-12/h3-4,9-11H,5-8,23H2,1-2H3,(H2,24,25,26)
Standard InChI Key: IIGMSCPNSBFJIP-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.3540 -28.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3529 -28.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0609 -29.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0591 -27.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7678 -28.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7685 -28.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4770 -29.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1853 -28.8561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1806 -28.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4715 -27.6306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8872 -27.6239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5973 -28.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3004 -27.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2996 -26.8034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5896 -26.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8803 -26.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0064 -26.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0045 -25.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6462 -27.6361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6448 -29.2721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4787 -30.0841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9386 -28.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9375 -28.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7141 -26.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7146 -27.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4224 -28.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1302 -27.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1257 -26.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4173 -26.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8394 -28.0190 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8310 -26.3788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
9 11 1 0
14 17 1 0
17 18 2 0
1 19 1 0
2 20 1 0
7 21 1 0
19 22 1 0
20 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
17 24 1 0
27 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.91Molecular Weight (Monoisotopic): 442.1520AlogP: 2.43#Rotatable Bonds: 4Polar Surface Area: 119.83Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.24CX LogP: 2.37CX LogD: 2.14Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -1.29
References 1. Orahoske CM,Li Y,Petty A,Salem FM,Hanna J,Zhang W,Su B,Wang B. (2020) Dimeric small molecule agonists of EphA2 receptor inhibit glioblastoma cell growth., 28 (18): [PMID:32828423 ] [10.1016/j.bmc.2020.115656 ]