N-(4-aminophenyl)-6-methyl-2-oxo-chromene-3-carboxamide

ID: ALA4743471

PubChem CID: 162645692

Max Phase: Preclinical

Molecular Formula: C17H14N2O3

Molecular Weight: 294.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2oc(=O)c(C(=O)Nc3ccc(N)cc3)cc2c1

Standard InChI:  InChI=1S/C17H14N2O3/c1-10-2-7-15-11(8-10)9-14(17(21)22-15)16(20)19-13-5-3-12(18)4-6-13/h2-9H,18H2,1H3,(H,19,20)

Standard InChI Key:  BCOQZELHYUDVIX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    9.1798  -11.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8929  -11.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6023  -11.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6023  -12.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8955  -13.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1798  -12.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3196  -13.0592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0329  -12.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0329  -11.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3196  -11.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7460  -11.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7460  -10.5829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4593  -11.8190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1766  -11.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1769  -10.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8877  -10.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6012  -10.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6034  -11.4054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8942  -11.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3186  -10.1710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7460  -13.0592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4624  -11.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  3 10  1  0
  9 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 17 20  1  0
  8 21  2  0
  1 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743471

    ---

Associated Targets(Human)

F12 Tchem Coagulation factor XII (1450 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 294.31Molecular Weight (Monoisotopic): 294.1004AlogP: 2.94#Rotatable Bonds: 2
Polar Surface Area: 85.33Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.75CX LogP: 2.49CX LogD: 2.49
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.56Np Likeness Score: -1.08

References

1. Davoine C,Bouckaert C,Fillet M,Pochet L.  (2020)  Factor XII/XIIa inhibitors: Their discovery, development, and potential indications.,  208  [PMID:32883641] [10.1016/j.ejmech.2020.112753]

Source