The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((1H-indazol-5-yl)methylene)-2-oxoindolin-5-yl)-3-morpholinopropanamide ID: ALA4743541
PubChem CID: 162646952
Max Phase: Preclinical
Molecular Formula: C23H23N5O3
Molecular Weight: 417.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCN1CCOCC1)Nc1ccc2c(c1)/C(=C\c1ccc3[nH]ncc3c1)C(=O)N2
Standard InChI: InChI=1S/C23H23N5O3/c29-22(5-6-28-7-9-31-10-8-28)25-17-2-4-21-18(13-17)19(23(30)26-21)12-15-1-3-20-16(11-15)14-24-27-20/h1-4,11-14H,5-10H2,(H,24,27)(H,25,29)(H,26,30)/b19-12+
Standard InChI Key: VIXKNQDBQCQHPJ-XDHOZWIPSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
6.7755 -23.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7743 -23.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4824 -24.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4806 -22.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1892 -23.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1895 -23.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9681 -24.1513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4492 -23.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9677 -22.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0677 -22.6751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3601 -23.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6523 -22.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3603 -23.9011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9447 -23.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2369 -22.6758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -23.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2367 -21.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8214 -22.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5288 -21.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8212 -21.8590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2664 -23.4886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2200 -22.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6730 -21.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9293 -20.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3830 -20.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8797 -21.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3317 -21.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5799 -20.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9131 -19.7528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2528 -20.2394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5116 -21.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
20 19 1 0
8 21 2 0
9 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 28 2 0
27 26 2 0
26 23 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1801AlogP: 2.72#Rotatable Bonds: 5Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.32CX Basic pKa: 7.07CX LogP: 1.74CX LogD: 1.57Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.76
References 1. Yao D,Ruhan A,Jiang J,Huang J,Wang J,Han W. (2020) Design, synthesis and biological evaluation of 2-indolinone derivatives as PAK1 inhibitors in MDA-MB-231 cells., 30 (17): [PMID:32738980 ] [10.1016/j.bmcl.2020.127355 ]