The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((6-(2-((2,6-Dichloro-3,5-dimethoxyphenyl)amino)pyridin-3-yl)pyrimidin-4-yl)amino)-5-(prop-2-yn-1-yloxy)phenyl)-acrylamide ID: ALA4743550
PubChem CID: 162647091
Max Phase: Preclinical
Molecular Formula: C29H24Cl2N6O4
Molecular Weight: 591.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOc1ccc(Nc2cc(-c3cccnc3Nc3c(Cl)c(OC)cc(OC)c3Cl)ncn2)c(NC(=O)C=C)c1
Standard InChI: InChI=1S/C29H24Cl2N6O4/c1-5-12-41-17-9-10-19(21(13-17)36-25(38)6-2)35-24-14-20(33-16-34-24)18-8-7-11-32-29(18)37-28-26(30)22(39-3)15-23(40-4)27(28)31/h1,6-11,13-16H,2,12H2,3-4H3,(H,32,37)(H,36,38)(H,33,34,35)
Standard InChI Key: HQSYHGFDQHQMSJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
3.8779 -13.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8768 -14.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5916 -14.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3081 -14.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3053 -13.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5898 -13.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0182 -13.1778 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.5914 -15.6619 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.1620 -14.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5874 -12.3588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3007 -11.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4478 -14.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0233 -14.8350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7372 -14.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4489 -14.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1623 -14.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1615 -13.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4413 -13.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7309 -13.5983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4518 -15.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7356 -16.0685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7353 -16.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4504 -17.3061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1673 -16.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1640 -16.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8833 -17.2990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5963 -16.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3087 -17.2948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0212 -16.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0186 -16.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2977 -15.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5880 -16.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3102 -18.1199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0254 -18.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0269 -19.3562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7392 -18.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4544 -18.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7311 -15.6384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4476 -16.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1601 -15.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8709 -15.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
3 8 1 0
2 9 1 0
6 10 1 0
10 11 1 0
9 12 1 0
4 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
15 20 1 0
24 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
28 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 2 0
30 38 1 0
38 39 1 0
39 40 1 0
40 41 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 591.46Molecular Weight (Monoisotopic): 590.1236AlogP: 6.49#Rotatable Bonds: 11Polar Surface Area: 119.52Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.02CX Basic pKa: 4.20CX LogP: 5.89CX LogD: 5.89Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.13Np Likeness Score: -0.92
References 1. Rezende Miranda R,Fu Y,Chen X,Perino J,Cao P,Carpten J,Chen Y,Zhang C. (2020) Development of a Potent and Specific FGFR4 Inhibitor for the Treatment of Hepatocellular Carcinoma., 63 (20): [PMID:33030342 ] [10.1021/acs.jmedchem.0c00044 ]