The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((S)-1-(((S)-1-(((S)-1-((3-acetylphenyl)amino)-5-methyl-1,2-dioxohexan-3-yl)amino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamic acid benzyl ester ID: ALA4743601
PubChem CID: 162645405
Max Phase: Preclinical
Molecular Formula: C40H47N5O7
Molecular Weight: 709.84
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cccc(NC(=O)C(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)OCc2ccccc2)c1
Standard InChI: InChI=1S/C40H47N5O7/c1-24(2)18-33(36(47)39(50)42-30-15-11-14-28(20-30)26(5)46)43-38(49)35(21-29-22-41-32-17-10-9-16-31(29)32)44-37(48)34(19-25(3)4)45-40(51)52-23-27-12-7-6-8-13-27/h6-17,20,22,24-25,33-35,41H,18-19,21,23H2,1-5H3,(H,42,50)(H,43,49)(H,44,48)(H,45,51)/t33-,34-,35-/m0/s1
Standard InChI Key: NZVFNFWVRSOYCM-IMKBVMFZSA-N
Molfile:
RDKit 2D
52 55 0 0 0 0 0 0 0 0999 V2000
27.7835 -23.8423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4991 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2146 -23.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4991 -22.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2146 -24.6679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9302 -23.4316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6415 -23.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3570 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0725 -23.8423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3570 -22.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7881 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5036 -23.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2191 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5036 -24.6679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9347 -23.8423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2191 -22.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6502 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3608 -23.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0758 -23.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0762 -22.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3557 -22.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6477 -22.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0680 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7881 -22.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0725 -22.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0725 -21.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2436 -22.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6415 -24.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0680 -22.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3525 -23.8423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6369 -23.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9214 -23.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2107 -23.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4956 -23.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4952 -24.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2158 -25.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9237 -24.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3570 -25.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6654 -25.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1130 -24.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2506 -26.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4436 -25.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8906 -26.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1434 -27.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9544 -27.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5038 -26.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2105 -22.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2105 -21.3739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9218 -22.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3517 -21.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0612 -20.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6384 -20.9661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 1
3 5 2 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
13 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
1 23 1 0
11 24 1 1
24 25 1 0
25 26 1 0
25 27 1 0
7 28 1 6
23 29 2 0
23 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
28 38 1 0
38 42 1 0
41 39 1 0
39 40 1 0
40 38 2 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
4 47 1 0
47 48 1 0
47 49 1 0
21 50 1 0
50 51 1 0
50 52 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 709.84Molecular Weight (Monoisotopic): 709.3475AlogP: 5.48#Rotatable Bonds: 17Polar Surface Area: 175.56Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.35CX Basic pKa: ┄CX LogP: 6.06CX LogD: 6.06Aromatic Rings: 4Heavy Atoms: 52QED Weighted: 0.07Np Likeness Score: -0.41
References 1. Wang J,Liang B,Chen Y,Fuk-Woo Chan J,Yuan S,Ye H,Nie L,Zhou J,Wu Y,Wu M,Huang LS,An J,Warshel A,Yuen KY,Ciechanover A,Huang Z,Xu Y. (2021) A new class of α-ketoamide derivatives with potent anticancer and anti-SARS-CoV-2 activities., 215 [PMID:33639344 ] [10.1016/j.ejmech.2021.113267 ]