The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3Z,6Z)-1-Allyl-3-heptylidene-6-(2-methoxybenzylidene)piperazine-2,5-dione ID: ALA4743607
PubChem CID: 162645407
Max Phase: Preclinical
Molecular Formula: C22H28N2O3
Molecular Weight: 368.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCn1c(=O)/c(=C/CCCCCC)[nH]c(=O)/c1=C/c1ccccc1OC
Standard InChI: InChI=1S/C22H28N2O3/c1-4-6-7-8-9-13-18-22(26)24(15-5-2)19(21(25)23-18)16-17-12-10-11-14-20(17)27-3/h5,10-14,16H,2,4,6-9,15H2,1,3H3,(H,23,25)/b18-13-,19-16-
Standard InChI Key: CGZWQGBCXBCQQQ-RGDAZOANSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
2.1447 -10.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1436 -11.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8516 -11.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5613 -11.3146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5585 -10.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8499 -10.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2646 -10.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9739 -10.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6800 -10.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9770 -11.3038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3893 -10.4812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3924 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6862 -11.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2708 -11.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2739 -12.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5677 -12.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6893 -12.5269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6770 -9.2581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1016 -11.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8078 -11.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5170 -11.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2232 -11.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9324 -11.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6386 -11.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3478 -11.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8474 -9.2695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5539 -8.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
8 10 1 0
9 11 1 0
11 12 1 0
12 13 1 0
10 13 1 0
10 14 1 0
14 15 1 0
15 16 2 0
13 17 2 0
9 18 2 0
12 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
6 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 368.48Molecular Weight (Monoisotopic): 368.2100AlogP: 2.31#Rotatable Bonds: 9Polar Surface Area: 64.09Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.65CX Basic pKa: ┄CX LogP: 4.39CX LogD: 4.22Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.55Np Likeness Score: 0.09
References 1. Liao SR,Qin XC,Wang Z,Li D,Xu L,Li JS,Tu ZC,Liu Y. (2016) Design, synthesis and cytotoxic activities of novel 2,5-diketopiperazine derivatives., 121 [PMID:27318124 ] [10.1016/j.ejmech.2016.06.002 ]