Balansechromone B

ID: ALA4743621

PubChem CID: 162645560

Max Phase: Preclinical

Molecular Formula: C19H18O5

Molecular Weight: 326.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CCc2oc3ccccc3c(=O)c2OC)ccc1O

Standard InChI:  InChI=1S/C19H18O5/c1-22-17-11-12(7-9-14(17)20)8-10-16-19(23-2)18(21)13-5-3-4-6-15(13)24-16/h3-7,9,11,20H,8,10H2,1-2H3

Standard InChI Key:  MKONXVZXOUSYSX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    5.6820   -7.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6809   -8.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3957   -8.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3939   -6.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1094   -7.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1081   -8.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8211   -8.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5398   -8.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5409   -7.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8234   -6.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8188   -9.4046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2564   -6.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9699   -7.3437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6854   -6.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3945   -7.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1095   -6.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1119   -6.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3934   -5.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6813   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8228   -7.3544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8203   -8.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8268   -5.7021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2531   -8.5832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9756   -8.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  7 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 16 20  1  0
 20 21  1  0
 17 22  1  0
  8 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743621

    ---

Associated Targets(Human)

NHDF (1164 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 326.35Molecular Weight (Monoisotopic): 326.1154AlogP: 3.30#Rotatable Bonds: 5
Polar Surface Area: 68.90Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.26CX Basic pKa: CX LogP: 3.38CX LogD: 3.38
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: 0.57

References

1. Cho HM,Lee YR,Lee BW,Zhang M,Ryu B,Nghiem DT,Pham HT,Oh WK.  (2020)  Phenolic Constituents of the Roots of Rhamnoneuron balansae with Senolytic Activity.,  83  (12): [PMID:33256407] [10.1021/acs.jnatprod.0c00885]

Source