The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-Methoxybenzyl)-N-methyl-5-(methylsulfonamido)-N-(prop-2-yn-1-yl)-1H-indole-2-carboxamide ID: ALA4743658
PubChem CID: 162645991
Max Phase: Preclinical
Molecular Formula: C22H23N3O4S
Molecular Weight: 425.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(C)C(=O)c1cc2cc(NS(C)(=O)=O)ccc2n1Cc1ccc(OC)cc1
Standard InChI: InChI=1S/C22H23N3O4S/c1-5-12-24(2)22(26)21-14-17-13-18(23-30(4,27)28)8-11-20(17)25(21)15-16-6-9-19(29-3)10-7-16/h1,6-11,13-14,23H,12,15H2,2-4H3
Standard InChI Key: LJUWJNWGKQVUIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
31.8044 -27.2149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4000 -26.5092 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.9910 -27.2123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8156 -26.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8156 -27.3264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5209 -27.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5209 -26.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2303 -26.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2302 -27.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0082 -27.5744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4907 -26.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0083 -26.2496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3079 -26.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7165 -27.6197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7165 -26.2043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3079 -28.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5337 -27.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9423 -28.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0030 -28.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2927 -28.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5911 -28.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8813 -28.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8757 -29.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5857 -30.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2927 -29.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1659 -30.0080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4603 -29.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3526 -29.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1058 -26.1001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6904 -26.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 7 2 0
5 6 2 0
6 9 1 0
8 7 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
11 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
14 17 1 0
17 18 1 0
10 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
18 28 3 0
4 29 1 0
29 2 1 0
2 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.51Molecular Weight (Monoisotopic): 425.1409AlogP: 2.77#Rotatable Bonds: 7Polar Surface Area: 80.64Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.39CX Basic pKa: ┄CX LogP: 1.68CX LogD: 1.68Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.64
References 1. Vo, Sophie V., Banister, Samuel D., Freelander, Isaac, Werry, Eryn L., Reekie, Tristan A., Ittner, Lars M., Kassiou, Michael. (2020) Reversing binding sensitivity to A147T translocator protein, 11 (4): [PMID:33479652 ] [10.1039/c9md00580c ]