(E)-1-(3-(4-fluorophenyl)acryloyl)-3-(thiophene-2-carbonyl)imidazolidin-2-one

ID: ALA4743682

PubChem CID: 162646290

Max Phase: Preclinical

Molecular Formula: C17H13FN2O3S

Molecular Weight: 344.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(F)cc1)N1CCN(C(=O)c2cccs2)C1=O

Standard InChI:  InChI=1S/C17H13FN2O3S/c18-13-6-3-12(4-7-13)5-8-15(21)19-9-10-20(17(19)23)16(22)14-2-1-11-24-14/h1-8,11H,9-10H2/b8-5+

Standard InChI Key:  DDQDWNWUEDSNAF-VMPITWQZSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    8.3875  -26.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4861  -25.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4850  -26.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1997  -26.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9162  -26.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9133  -25.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1979  -25.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6262  -25.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3422  -25.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0551  -25.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7712  -25.6439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0520  -24.4091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8629  -26.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6705  -26.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0803  -25.9158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5260  -25.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6946  -24.4972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9005  -25.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2331  -25.0714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7701  -26.8975    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1399  -27.2780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8087  -27.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4740  -27.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2163  -26.4901    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
 16 17  2  0
 15 18  1  0
 18  1  1  0
 18 19  2  0
  3 20  1  0
  1 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743682

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.37Molecular Weight (Monoisotopic): 344.0631AlogP: 3.01#Rotatable Bonds: 3
Polar Surface Area: 57.69Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.16CX LogD: 3.16
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.80Np Likeness Score: -1.36

References

1. Ji L,Qu L,Wang C,Peng W,Li S,Yang H,Luo H,Yin F,Lu D,Liu X,Kong L,Wang X.  (2021)  Identification and optimization of piperlongumine analogues as potential antioxidant and anti-inflammatory agents via activation of Nrf2.,  210  [PMID:33148493] [10.1016/j.ejmech.2020.112965]

Source