The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3Z,6Z)-1-Allyl-6-(4-methoxybenzylidene)-3-octylidenepiperazine-2,5-dione ID: ALA4743751
PubChem CID: 162646956
Max Phase: Preclinical
Molecular Formula: C23H30N2O3
Molecular Weight: 382.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCn1c(=O)/c(=C/CCCCCCC)[nH]c(=O)/c1=C/c1ccc(OC)cc1
Standard InChI: InChI=1S/C23H30N2O3/c1-4-6-7-8-9-10-11-20-23(27)25(16-5-2)21(22(26)24-20)17-18-12-14-19(28-3)15-13-18/h5,11-15,17H,2,4,6-10,16H2,1,3H3,(H,24,26)/b20-11-,21-17-
Standard InChI Key: JCDOHZUMDZABMC-DSWZVGNYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
2.9124 -9.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9113 -10.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6193 -10.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3290 -10.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3261 -9.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6175 -9.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0323 -9.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7415 -9.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4477 -9.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7446 -10.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1570 -9.6806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1600 -10.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4539 -10.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0385 -10.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0415 -11.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3354 -12.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4569 -11.7262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4446 -8.4574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8693 -10.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5754 -10.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2847 -10.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9908 -10.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7001 -10.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4063 -10.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1155 -10.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8217 -10.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2032 -10.9224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4958 -10.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
8 10 1 0
9 11 1 0
11 12 1 0
12 13 1 0
10 13 1 0
10 14 1 0
14 15 1 0
15 16 2 0
13 17 2 0
9 18 2 0
12 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
2 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.50Molecular Weight (Monoisotopic): 382.2256AlogP: 2.70#Rotatable Bonds: 10Polar Surface Area: 64.09Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.65CX Basic pKa: ┄CX LogP: 4.84CX LogD: 4.67Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: 0.23
References 1. Liao SR,Qin XC,Wang Z,Li D,Xu L,Li JS,Tu ZC,Liu Y. (2016) Design, synthesis and cytotoxic activities of novel 2,5-diketopiperazine derivatives., 121 [PMID:27318124 ] [10.1016/j.ejmech.2016.06.002 ]