ethyl 2-((4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)sulfonyl)acetate

ID: ALA4743757

PubChem CID: 162646960

Max Phase: Preclinical

Molecular Formula: C24H27ClN4O7S2

Molecular Weight: 583.09

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)CS(=O)(=O)c1ccc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC)c1

Standard InChI:  InChI=1S/C24H27ClN4O7S2/c1-5-36-22(30)14-37(31,32)16-10-11-18(20(12-16)35-4)28-24-26-13-17(25)23(29-24)27-19-8-6-7-9-21(19)38(33,34)15(2)3/h6-13,15H,5,14H2,1-4H3,(H2,26,27,28,29)

Standard InChI Key:  MUTFIMYCMYDHBB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   41.6891  -25.3494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1019  -26.0593    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.5103  -25.3470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8574  -28.5191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0402  -28.5191    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.4488  -29.2269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1560  -26.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1549  -27.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8629  -27.7046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5726  -27.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5698  -26.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8611  -26.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2809  -27.7027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9880  -27.2930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4468  -27.7037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7395  -27.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7446  -26.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0381  -26.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3291  -26.4765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3311  -27.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0382  -27.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6930  -27.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3996  -27.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3988  -26.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6854  -26.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9818  -26.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3349  -28.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8142  -26.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5207  -26.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2296  -26.4656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6931  -28.5181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4009  -28.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6249  -28.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3395  -29.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4482  -26.0677    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   43.5183  -25.2419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9361  -26.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6450  -26.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
  8 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 14  1  0
 24  2  1  0
 21  5  1  0
  5 27  1  0
  2 28  1  0
 28 29  1  0
 29 30  1  0
 22 31  1  0
 31 32  1  0
 27 33  1  0
 27 34  1  0
  7 35  1  0
 29 36  2  0
 30 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743757

    ---

Associated Targets(Human)

KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCC78 (247 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 583.09Molecular Weight (Monoisotopic): 582.1010AlogP: 4.14#Rotatable Bonds: 11
Polar Surface Area: 153.65Molecular Species: NEUTRALHBA: 11HBD: 2
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.10CX Basic pKa: 1.75CX LogP: 3.84CX LogD: 3.84
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.60

References

1. Zhu M,Li W,Zhao T,Chen Y,Li T,Wei S,Guo M,Zhai X.  (2020)  Fragment-based modification of 2,4-diarylaminopyrimidine derivatives as ALK and ROS1 dual inhibitors to overcome secondary mutants.,  28  (20.0): [PMID:33069075] [10.1016/j.bmc.2020.115719]

Source