The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 2-((4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)sulfonyl)acetate ID: ALA4743757
PubChem CID: 162646960
Max Phase: Preclinical
Molecular Formula: C24H27ClN4O7S2
Molecular Weight: 583.09
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CS(=O)(=O)c1ccc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC)c1
Standard InChI: InChI=1S/C24H27ClN4O7S2/c1-5-36-22(30)14-37(31,32)16-10-11-18(20(12-16)35-4)28-24-26-13-17(25)23(29-24)27-19-8-6-7-9-21(19)38(33,34)15(2)3/h6-13,15H,5,14H2,1-4H3,(H2,26,27,28,29)
Standard InChI Key: MUTFIMYCMYDHBB-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
41.6891 -25.3494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1019 -26.0593 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.5103 -25.3470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8574 -28.5191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0402 -28.5191 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.4488 -29.2269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1560 -26.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1549 -27.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8629 -27.7046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5726 -27.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5698 -26.4725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8611 -26.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2809 -27.7027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9880 -27.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4468 -27.7037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7395 -27.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7446 -26.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0381 -26.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3291 -26.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3311 -27.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0382 -27.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6930 -27.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3996 -27.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3988 -26.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6854 -26.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9818 -26.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3349 -28.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8142 -26.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5207 -26.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2296 -26.4656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6931 -28.5181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.4009 -28.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6249 -28.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3395 -29.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4482 -26.0677 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.5183 -25.2419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.9361 -26.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6450 -26.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
8 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 14 1 0
24 2 1 0
21 5 1 0
5 27 1 0
2 28 1 0
28 29 1 0
29 30 1 0
22 31 1 0
31 32 1 0
27 33 1 0
27 34 1 0
7 35 1 0
29 36 2 0
30 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.09Molecular Weight (Monoisotopic): 582.1010AlogP: 4.14#Rotatable Bonds: 11Polar Surface Area: 153.65Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.10CX Basic pKa: 1.75CX LogP: 3.84CX LogD: 3.84Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.60
References 1. Zhu M,Li W,Zhao T,Chen Y,Li T,Wei S,Guo M,Zhai X. (2020) Fragment-based modification of 2,4-diarylaminopyrimidine derivatives as ALK and ROS1 dual inhibitors to overcome secondary mutants., 28 (20.0): [PMID:33069075 ] [10.1016/j.bmc.2020.115719 ]