(S)-2-((4'-chlorobiphenyl-4-yl)methyl)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)thiazole-4-carboxamide

ID: ALA4743815

PubChem CID: 155754551

Max Phase: Preclinical

Molecular Formula: C24H19ClF2N4O2S

Molecular Weight: 500.96

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)c1csc(Cc2ccc(-c3ccc(Cl)cc3)cc2)n1

Standard InChI:  InChI=1S/C24H19ClF2N4O2S/c25-18-7-5-17(6-8-18)16-3-1-15(2-4-16)9-21-30-20(13-34-21)23(33)29-12-22(32)31-14-24(26,27)10-19(31)11-28/h1-8,13,19H,9-10,12,14H2,(H,29,33)/t19-/m0/s1

Standard InChI Key:  PCRACKRCKRHQQW-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    8.8224  -18.5730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2132  -19.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6475  -18.5981    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.4616  -21.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8969  -20.5911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7170  -20.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9144  -19.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5831  -19.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2478  -21.1663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7786  -21.7962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6370  -21.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8510  -22.0193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2018  -21.9663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3773  -21.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9421  -22.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9879  -21.2126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1199  -22.7040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9225  -23.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6235  -23.9403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2538  -23.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1585  -23.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0460  -24.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2800  -24.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1672  -25.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8192  -26.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5862  -25.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6953  -25.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7112  -27.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9461  -27.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8344  -28.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4870  -28.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2537  -28.3989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3616  -27.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3767  -29.5328    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  2  8  1  0
  8  5  1  0
  6  9  1  1
  9 10  3  0
  4 11  1  0
  4 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 15  2  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 25 28  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743815

    ---

Associated Targets(Human)

FAP Tchem Fibroblast activation protein alpha (827 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP4 Tclin Dipeptidyl peptidase IV (7109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PREP Tchem Prolyl endopeptidase (1176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.96Molecular Weight (Monoisotopic): 500.0885AlogP: 4.54#Rotatable Bonds: 6
Polar Surface Area: 86.09Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.97CX LogD: 3.97
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.25

References

1. Jung HJ,Nam EH,Park JY,Ghosh P,Kim IS.  (2021)  Identification of BR102910 as a selective fibroblast activation protein (FAP) inhibitor.,  37  [PMID:33571650] [10.1016/j.bmcl.2021.127846]

Source