5-[2-[4-[(2R)-pyrrolidine-2-carbonyl]piperazin-1-yl]phenyl]-N-(3-pyrrolidin-1-ylpropyl)pyridine-3-carboxamide

ID: ALA4743828

PubChem CID: 162645274

Max Phase: Preclinical

Molecular Formula: C28H38N6O2

Molecular Weight: 490.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCN1CCCC1)c1cncc(-c2ccccc2N2CCN(C(=O)[C@H]3CCCN3)CC2)c1

Standard InChI:  InChI=1S/C28H38N6O2/c35-27(31-11-6-14-32-12-3-4-13-32)23-19-22(20-29-21-23)24-7-1-2-9-26(24)33-15-17-34(18-16-33)28(36)25-8-5-10-30-25/h1-2,7,9,19-21,25,30H,3-6,8,10-18H2,(H,31,35)/t25-/m1/s1

Standard InChI Key:  CLEZJKKVXIZRPG-RUZDIDTESA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    6.8704  -11.1435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8693  -11.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5773  -12.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2911  -11.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2883  -11.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5755  -10.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9986  -10.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7119  -11.1345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9955   -9.9032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4222  -10.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1356  -11.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8459  -10.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5593  -11.1239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6443  -11.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4484  -12.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8544  -11.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3011  -10.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5764  -13.1884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8665  -13.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8649  -14.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5725  -14.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2832  -14.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2813  -13.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1598  -13.1850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1660  -12.3697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4634  -11.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7523  -12.3628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7482  -13.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4553  -13.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0471  -11.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0523  -11.1325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3369  -12.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5941  -12.0188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0435  -12.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4476  -13.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2479  -13.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  3 18  1  0
 19 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
 30 31  2  0
 32 30  1  1
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743828

    ---

Associated Targets(Human)

SMYD2 Tchem N-lysine methyltransferase SMYD2 (395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.65Molecular Weight (Monoisotopic): 490.3056AlogP: 2.36#Rotatable Bonds: 8
Polar Surface Area: 80.81Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.93CX LogP: 1.27CX LogD: -2.96
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: -1.18

References

1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C.  (2020)  Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors.,  30  (22): [PMID:33011288] [10.1016/j.bmcl.2020.127598]

Source