(4aS,6aS,6bR,8aR,9R,10S,12aR,14bS)-ethyl 10-hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylate

ID: ALA4743833

PubChem CID: 24721023

Max Phase: Preclinical

Molecular Formula: C32H52O4

Molecular Weight: 500.76

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@H](O)[C@@](C)(CO)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2

Standard InChI:  InChI=1S/C32H52O4/c1-8-36-26(35)32-17-15-27(2,3)19-22(32)21-9-10-24-28(4)13-12-25(34)29(5,20-33)23(28)11-14-31(24,7)30(21,6)16-18-32/h9,22-25,33-34H,8,10-20H2,1-7H3/t22-,23+,24+,25-,28-,29-,30+,31+,32-/m0/s1

Standard InChI Key:  BIDWZLRBSOJLMG-PRGPMLBASA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    9.9939  -16.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7129  -17.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1644  -14.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5810  -17.4267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0018  -15.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5931  -14.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2873  -16.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0364  -13.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2959  -14.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7089  -15.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7164  -16.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6086  -13.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4282  -16.6037    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2873  -17.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7466  -12.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8623  -15.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3304  -13.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9139  -12.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5859  -15.3882    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4407  -14.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9234  -17.8150    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1477  -17.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1473  -16.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1390  -15.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8763  -14.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9982  -17.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0076  -15.4050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0145  -14.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4353  -15.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8540  -16.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5650  -16.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4283  -17.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0026  -18.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2864  -15.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2918  -18.6615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0067  -16.2276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7204  -14.9945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4323  -15.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1452  -14.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 29 23  1  0
 14  4  1  1
  6 19  1  1
  7 14  1  0
 29 13  1  6
 25  3  2  0
 26  1  1  1
 23 16  1  0
 17 12  1  0
 26 14  1  0
 29 20  1  0
 34  9  1  0
  3 20  1  0
 15 17  1  0
  6 12  1  0
  9 28  1  0
 17 18  1  0
 11 10  1  1
 28  8  1  0
 16 31  1  0
  9 27  1  1
  2 21  1  6
 26 33  1  0
 11  2  1  0
 11  5  1  0
 31 34  1  0
 25 16  1  0
 32 22  1  0
 23 24  1  1
  6  9  1  0
 16 30  1  6
 35 33  1  0
 26  2  1  0
  7  5  1  0
  2 32  1  0
 22 23  1  0
  8 17  1  0
 25  6  1  0
 11 29  1  0
 27 36  2  0
 27 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Associated Targets(non-human)

Leishmania mexicana (936 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.76Molecular Weight (Monoisotopic): 500.3866AlogP: 6.68#Rotatable Bonds: 3
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.82CX LogD: 5.82
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: 2.94

References

1. Anderson, Orlagh, Beckett, Joseph, Briggs, Carla C., Natrass, Liam A., Cranston, Charles F., Wilkinson, Elizabeth J., Owen, Jack H., Mir Williams, Rhodri, Loukaidis, Angelos, Bouillon, Marc E., Pritchard, Deiniol, Lahmann, Martina, Baird, Mark S., Denny, Paul W..  (2020)  An investigation of the antileishmanial properties of semi-synthetic saponins,  11  (7): [PMID:33479679] [10.1039/d0md00123f]

Source