The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-acrylamido-N-(5-(4-(dimethylamino)piperidin-1-yl)thiazol-2-yl)benzamide ID: ALA4743840
PubChem CID: 145749880
Max Phase: Preclinical
Molecular Formula: C20H25N5O2S
Molecular Weight: 399.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(C(=O)Nc2ncc(N3CCC(N(C)C)CC3)s2)c1
Standard InChI: InChI=1S/C20H25N5O2S/c1-4-17(26)22-15-7-5-6-14(12-15)19(27)23-20-21-13-18(28-20)25-10-8-16(9-11-25)24(2)3/h4-7,12-13,16H,1,8-11H2,2-3H3,(H,22,26)(H,21,23,27)
Standard InChI Key: RRPYRSMWUNOMAJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
17.2339 -10.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2327 -11.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9408 -12.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6505 -11.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6476 -10.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9390 -10.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3553 -10.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0646 -10.9403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3522 -9.7172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7707 -10.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5162 -10.8570 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.0607 -10.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6494 -9.5414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8508 -9.7145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8715 -10.3266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2053 -11.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0145 -11.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4960 -10.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1622 -9.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3470 -9.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5261 -10.5411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5259 -9.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2335 -9.3151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8181 -9.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8179 -8.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3087 -10.5822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6411 -11.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7891 -9.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 9 2 0
5 7 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
12 15 1 0
1 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 2 0
18 26 1 0
26 27 1 0
26 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.52Molecular Weight (Monoisotopic): 399.1729AlogP: 3.05#Rotatable Bonds: 6Polar Surface Area: 77.57Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.61CX Basic pKa: 9.77CX LogP: 2.59CX LogD: 0.35Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: -1.66
References 1. (2020) Inhibitors of cyclin-dependent kinases,