The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((4-Ethoxy-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)-3-isopropoxyphenyl)(morpholino)methanone ID: ALA4743843
PubChem CID: 118286352
Max Phase: Preclinical
Molecular Formula: C22H27N5O4
Molecular Weight: 425.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1nc(Nc2ccc(C(=O)N3CCOCC3)cc2OC(C)C)nc2[nH]ccc12
Standard InChI: InChI=1S/C22H27N5O4/c1-4-30-20-16-7-8-23-19(16)25-22(26-20)24-17-6-5-15(13-18(17)31-14(2)3)21(28)27-9-11-29-12-10-27/h5-8,13-14H,4,9-12H2,1-3H3,(H2,23,24,25,26)
Standard InChI Key: JNEYRGCOLYRABZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
29.8838 -24.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8827 -25.3146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5907 -25.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3004 -25.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2976 -24.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5890 -24.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0037 -24.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0007 -23.2630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1747 -25.7226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4673 -25.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4725 -24.4964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7659 -24.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7660 -25.7222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0589 -25.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0566 -24.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2734 -24.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7916 -24.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2771 -25.5732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7676 -23.2701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0607 -22.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0624 -22.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7130 -24.4861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7135 -25.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4186 -25.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1272 -25.2986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1261 -24.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4164 -24.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5905 -26.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2982 -26.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2980 -27.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0060 -26.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
2 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 15 2 0
14 13 2 0
13 10 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
12 19 1 0
19 20 1 0
20 21 1 0
7 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
3 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.49Molecular Weight (Monoisotopic): 425.2063AlogP: 3.36#Rotatable Bonds: 7Polar Surface Area: 101.60Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.81CX Basic pKa: 4.69CX LogP: 3.12CX LogD: 3.12Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -1.56
References 1. Ding X,Stasi LP,Ho MH,Zhao B,Wang H,Long K,Xu Q,Sang Y,Sun C,Hu H,Yu H,Wan Z,Wang L,Edge C,Liu Q,Li Y,Dong K,Guan X,Tattersall FD,Reith AD,Ren F. (2018) Discovery of 4-ethoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amines as potent, selective and orally bioavailable LRRK2 inhibitors., 28 (9.0): [PMID:29588215 ] [10.1016/j.bmcl.2018.03.045 ]