(+/-)-2-(5-(3-Chloro-4-((1-(pyridin-2-yl)ethyl)amino)quinolin-6-yl)-pyrimidin-2-yl)propan-2-ol

ID: ALA4743885

PubChem CID: 162645860

Max Phase: Preclinical

Molecular Formula: C23H22ClN5O

Molecular Weight: 419.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(Nc1c(Cl)cnc2ccc(-c3cnc(C(C)(C)O)nc3)cc12)c1ccccn1

Standard InChI:  InChI=1S/C23H22ClN5O/c1-14(19-6-4-5-9-25-19)29-21-17-10-15(7-8-20(17)26-13-18(21)24)16-11-27-22(28-12-16)23(2,3)30/h4-14,30H,1-3H3,(H,26,29)

Standard InChI Key:  SLKZPRFZJOVYEX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.9296   -8.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7468   -8.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3382   -7.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4548   -7.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4548   -6.8496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1639   -6.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8689   -6.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8689   -7.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1639   -8.0795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7011   -5.2152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4102   -5.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4102   -6.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7011   -6.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9961   -6.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2870   -6.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5780   -6.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5780   -5.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2870   -5.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9961   -5.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7011   -7.6709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4102   -8.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1152   -7.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4102   -8.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7011   -9.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7011  -10.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4102  -10.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1152  -10.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1152   -9.3053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1152   -6.8496    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7512   -8.8967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 10 19  1  0
 14 19  1  0
 21 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 21 23  1  0
 20 21  1  0
 13 20  1  0
 12 29  1  0
  7 16  1  0
  2  4  1  0
  2 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743885

    ---

Associated Targets(Human)

TNF Tclin TNF-alpha (1897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.92Molecular Weight (Monoisotopic): 419.1513AlogP: 5.14#Rotatable Bonds: 5
Polar Surface Area: 83.82Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.36CX Basic pKa: 6.19CX LogP: 3.65CX LogD: 3.63
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.06

References

1. Xiao HY,Li N,Duan JJ,Jiang B,Lu Z,Ngu K,Tino J,Kopcho LM,Lu H,Chen J,Tebben AJ,Sheriff S,Chang CY,Yanchunas J,Calambur D,Gao M,Shuster DJ,Susulic V,Xie JH,Guarino VR,Wu DR,Gregor KR,Goldstine CB,Hynes J,Macor JE,Salter-Cid L,Burke JR,Shaw PJ,Dhar TGM.  (2020)  Biologic-like In Vivo Efficacy with Small Molecule Inhibitors of TNFα Identified Using Scaffold Hopping and Structure-Based Drug Design Approaches.,  63  (23): [PMID:33261314] [10.1021/acs.jmedchem.0c01732]

Source