1-(3-(3,4-dimethoxyphenyl)-1-hydroxy-11-(4-(trifluoromethyl)phenyl)-3,4-dihydro-2H-dibenzo[b,e][1,4]diazepin-10(11H)-yl)hexan-1-one

ID: ALA4743914

Max Phase: Preclinical

Molecular Formula: C34H35F3N2O4

Molecular Weight: 592.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCC(=O)N1c2ccccc2N=C2CC(c3ccc(OC)c(OC)c3)CC(O)=C2C1c1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C34H35F3N2O4/c1-4-5-6-11-31(41)39-27-10-8-7-9-25(27)38-26-18-23(22-14-17-29(42-2)30(20-22)43-3)19-28(40)32(26)33(39)21-12-15-24(16-13-21)34(35,36)37/h7-10,12-17,20,23,33,40H,4-6,11,18-19H2,1-3H3

Standard InChI Key:  NNTIUAYUQKWPSI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
    5.7971   -4.8810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5387   -4.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9325   -6.3324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2769   -4.9035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4539   -5.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2295   -5.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8294   -5.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6523   -4.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8713   -4.3479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1102   -6.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6053   -5.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7923   -5.7903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4831   -6.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9931   -7.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8043   -7.0849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6102   -5.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7901   -6.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5728   -6.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1763   -6.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9959   -5.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2135   -5.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5484   -3.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2631   -3.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2785   -2.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5717   -2.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8520   -2.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8443   -3.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1594   -4.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2897   -3.5498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3915   -4.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7539   -4.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9860   -4.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3483   -3.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5845   -4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5815   -1.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2982   -0.8513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.8746   -0.8343    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.5747   -0.4292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6923   -3.5465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9601   -6.3757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1380   -7.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7493   -7.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1423   -8.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  4  1  0
  1 11  1  0
  5  3  2  0
 10  3  1  0
  4  5  1  0
  4  9  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  2 22  1  0
  1 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 25 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
  9 39  1  0
 19 40  1  0
 40 41  1  0
 18 42  1  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743914

    ---

Associated Targets(non-human)

Cruzipain (33337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
rhodesain Rhodesain (1463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 592.66Molecular Weight (Monoisotopic): 592.2549AlogP: 8.85#Rotatable Bonds: 8
Polar Surface Area: 71.36Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.91CX Basic pKa: 1.81CX LogP: 7.36CX LogD: 7.24
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -0.50

References

1. Pereira GAN,da Silva EB,Braga SFP,Leite PG,Martins LC,Vieira RP,Soh WT,Villela FS,Costa FMR,Ray D,de Andrade SF,Brandstetter H,Oliveira RB,Caffrey CR,Machado FS,Ferreira RS.  (2019)  Discovery and characterization of trypanocidal cysteine protease inhibitors from the 'malaria box'.,  179  [PMID:31284086] [10.1016/j.ejmech.2019.06.062]

Source