The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(furan-2-ylmethylene)-2-oxoindolin-5-yl)-3-(piperidin-1-yl)propanamide ID: ALA4743990
PubChem CID: 162646987
Max Phase: Preclinical
Molecular Formula: C21H23N3O3
Molecular Weight: 365.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCN1CCCCC1)Nc1ccc2c(c1)/C(=C\c1ccco1)C(=O)N2
Standard InChI: InChI=1S/C21H23N3O3/c25-20(8-11-24-9-2-1-3-10-24)22-15-6-7-19-17(13-15)18(21(26)23-19)14-16-5-4-12-27-16/h4-7,12-14H,1-3,8-11H2,(H,22,25)(H,23,26)/b18-14+
Standard InChI Key: CCPIWDZIBSSFQT-NBVRZTHBSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
17.9892 -12.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9880 -13.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6961 -13.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6943 -11.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4029 -12.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4032 -13.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1818 -13.3380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6628 -12.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1814 -12.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2814 -11.8618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5738 -12.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5740 -13.0877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4800 -12.6752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4336 -11.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8866 -10.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8659 -11.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1583 -12.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4505 -11.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7429 -12.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4503 -11.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0351 -11.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7425 -10.6368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0349 -11.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0543 -9.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3465 -9.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7393 -9.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0721 -10.7162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 2 0
8 13 2 0
9 14 2 0
14 15 1 0
11 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
19 21 1 0
20 22 1 0
21 23 1 0
23 22 1 0
15 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 15 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 365.43Molecular Weight (Monoisotopic): 365.1739AlogP: 3.59#Rotatable Bonds: 5Polar Surface Area: 74.58Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.37CX Basic pKa: 9.26CX LogP: 2.54CX LogD: 0.68Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.79Np Likeness Score: -1.60
References 1. Yao D,Ruhan A,Jiang J,Huang J,Wang J,Han W. (2020) Design, synthesis and biological evaluation of 2-indolinone derivatives as PAK1 inhibitors in MDA-MB-231 cells., 30 (17): [PMID:32738980 ] [10.1016/j.bmcl.2020.127355 ]