The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)ethyl)phenyl 4-(trifluoromethyl)benzoate ID: ALA4744019
PubChem CID: 162647104
Max Phase: Preclinical
Molecular Formula: C22H23F3O8
Molecular Weight: 472.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Oc1ccc(CCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc(C(F)(F)F)cc1
Standard InChI: InChI=1S/C22H23F3O8/c23-22(24,25)14-5-3-13(4-6-14)20(30)32-15-7-1-12(2-8-15)9-10-31-21-19(29)18(28)17(27)16(11-26)33-21/h1-8,16-19,21,26-29H,9-11H2/t16-,17-,18+,19-,21-/m1/s1
Standard InChI Key: ZZGISPLNTYPWQU-GQUPQBGVSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
36.1029 -12.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9179 -12.3052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.5111 -11.5964 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.2120 -9.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2120 -10.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9173 -11.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6226 -10.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6226 -9.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9173 -9.4101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5031 -9.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5007 -8.5991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5049 -11.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3297 -11.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9173 -11.8617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3315 -9.4163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0380 -9.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7469 -9.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4534 -9.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4497 -10.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1553 -11.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8652 -10.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8650 -9.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1587 -9.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5706 -11.0643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2799 -10.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9860 -11.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2831 -9.8412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9776 -11.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6829 -12.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3932 -11.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3938 -11.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6879 -10.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0977 -13.1205 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 10 1 1
10 11 1 0
5 12 1 6
7 13 1 6
6 14 1 1
8 15 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 1 1 0
1 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.41Molecular Weight (Monoisotopic): 472.1345AlogP: 1.28#Rotatable Bonds: 7Polar Surface Area: 125.68Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 2.26CX LogD: 2.26Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: 0.63
References 1. Yang Z,Huang X,Lai W,Tang Y,Liu J,Wang Y,Chu K,Brown J,Hong G. (2021) Synthesis and identification of a novel derivative of salidroside as a selective, competitive inhibitor of monoamine oxidase B with enhanced neuroprotective properties., 209 [PMID:33097301 ] [10.1016/j.ejmech.2020.112935 ]