4-(2-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)ethyl)phenyl 4-(trifluoromethyl)benzoate

ID: ALA4744019

PubChem CID: 162647104

Max Phase: Preclinical

Molecular Formula: C22H23F3O8

Molecular Weight: 472.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Oc1ccc(CCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C22H23F3O8/c23-22(24,25)14-5-3-13(4-6-14)20(30)32-15-7-1-12(2-8-15)9-10-31-21-19(29)18(28)17(27)16(11-26)33-21/h1-8,16-19,21,26-29H,9-11H2/t16-,17-,18+,19-,21-/m1/s1

Standard InChI Key:  ZZGISPLNTYPWQU-GQUPQBGVSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   36.1029  -12.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9179  -12.3052    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.5111  -11.5964    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.2120   -9.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2120  -10.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9173  -11.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6226  -10.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6226   -9.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9173   -9.4101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5031   -9.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5007   -8.5991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5049  -11.0496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3297  -11.0496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9173  -11.8617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3315   -9.4163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0380   -9.8270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7469   -9.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4534   -9.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4497  -10.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1553  -11.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8652  -10.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8650   -9.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1587   -9.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5706  -11.0643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2799  -10.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9860  -11.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2831   -9.8412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9776  -11.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6829  -12.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3932  -11.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3938  -11.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6879  -10.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0977  -13.1205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  1  1
 10 11  1  0
  5 12  1  6
  7 13  1  6
  6 14  1  1
  8 15  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 30  1  1  0
  1 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4744019

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.41Molecular Weight (Monoisotopic): 472.1345AlogP: 1.28#Rotatable Bonds: 7
Polar Surface Area: 125.68Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.21CX Basic pKa: CX LogP: 2.26CX LogD: 2.26
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: 0.63

References

1. Yang Z,Huang X,Lai W,Tang Y,Liu J,Wang Y,Chu K,Brown J,Hong G.  (2021)  Synthesis and identification of a novel derivative of salidroside as a selective, competitive inhibitor of monoamine oxidase B with enhanced neuroprotective properties.,  209  [PMID:33097301] [10.1016/j.ejmech.2020.112935]

Source