The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(3-morpholinophenoxy)-4-oxo-3,4-dihydroquinazolin-7-yl)-2-((4-(trifluoromethyl)benzyl)oxy)acetamide ID: ALA4744025
PubChem CID: 162647220
Max Phase: Preclinical
Molecular Formula: C28H25F3N4O5
Molecular Weight: 554.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COCc1ccc(C(F)(F)F)cc1)Nc1cc2nc[nH]c(=O)c2cc1Oc1cccc(N2CCOCC2)c1
Standard InChI: InChI=1S/C28H25F3N4O5/c29-28(30,31)19-6-4-18(5-7-19)15-39-16-26(36)34-24-14-23-22(27(37)33-17-32-23)13-25(24)40-21-3-1-2-20(12-21)35-8-10-38-11-9-35/h1-7,12-14,17H,8-11,15-16H2,(H,34,36)(H,32,33,37)
Standard InChI Key: FRGYXZIYRYLYAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
8.0485 -12.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0473 -13.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7621 -13.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7603 -11.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4757 -12.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4791 -13.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1983 -13.6322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9186 -13.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9153 -12.3820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1915 -11.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1869 -11.1411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3291 -13.6291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3337 -11.9786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6166 -13.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3339 -11.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0481 -10.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0487 -9.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3337 -9.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6169 -9.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6197 -10.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6205 -12.3881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9002 -13.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9010 -9.5144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1876 -13.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4713 -13.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7587 -13.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7659 -12.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0542 -11.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3368 -12.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3356 -13.2002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0478 -13.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6278 -11.9556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6884 -11.1194 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1323 -12.6477 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0065 -11.4881 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.9015 -8.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1899 -8.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4743 -8.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4749 -9.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1912 -9.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
2 12 1 0
1 13 1 0
12 14 1 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 21 2 0
14 22 1 0
19 23 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
23 36 1 0
23 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.53Molecular Weight (Monoisotopic): 554.1777AlogP: 4.73#Rotatable Bonds: 8Polar Surface Area: 105.78Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.14CX Basic pKa: 4.53CX LogP: 3.78CX LogD: 3.78Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -1.57
References 1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G. (2020) Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy., 207 [PMID:32920426 ] [10.1016/j.ejmech.2020.112723 ]